|
|
| Line 1: |
Line 1: |
| − | [[Category:Metabolite]] | + | [[Category:Gene]] |
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-GLUCURONATE UDP-GLUCURONATE] == | + | == Gene Tiso_gene_15848 == |
| − | * smiles:
| + | |
| − | ** C(C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))OP(=O)([O-])OP(=O)([O-])OC3(OC(C([O-])=O)C(O)C(O)C(O)3)
| + | |
| − | * inchi key:
| + | |
| − | ** InChIKey=HDYANYHVCAPMJV-LXQIFKJMSA-K
| + | |
| − | * common name:
| + | |
| − | ** UDP-α-D-glucuronate
| + | |
| − | * molecular weight:
| + | |
| − | ** 577.265
| + | |
| | * Synonym(s): | | * Synonym(s): |
| − | ** (UDP-GlcA)1
| |
| − | ** UDP-D-glucuronic acid
| |
| − | ** UDP-glucuronic acid
| |
| − | ** udp-glcua
| |
| − | ** UDP-glucuronate
| |
| − | ** uridine diphosphate glucuronate
| |
| − | ** uridine diphosphate glucuronic acid
| |
| − | ** UDP-D-glucuronate
| |
| | | | |
| − | == Reaction(s) known to consume the compound == | + | == Reactions associated == |
| − | * [[RXN-14361]] | + | * [[PROTEIN-KINASE-RXN]] |
| − | * [[UDP-GLUCURONATE-DECARBOXYLASE-RXN]]
| + | ** [[pantograph]]-[[esiliculosus]] |
| − | * [[RXN-9000]] | + | == Pathways associated == |
| − | * [[RXN-10618]] | + | |
| − | * [[RXN-10619]]
| + | |
| − | * [[RXN-10616]]
| + | |
| − | * [[RXN-10617]]
| + | |
| − | * [[RXN-11060]]
| + | |
| − | * [[RXN66-83]]
| + | |
| − | * [[UGDC]]
| + | |
| − | * [[UDP-GLUCURONOSYLTRANSFERASE-RXN]]
| + | |
| − | * [[RXN-13608]]
| + | |
| − | * [[RXN-10609]]
| + | |
| − | * [[RXN-10608]]
| + | |
| − | * [[RXN-10607]]
| + | |
| − | * [[RXN-10606]]
| + | |
| − | * [[RXN-13607]]
| + | |
| − | * [[2.4.1.135-RXN]]
| + | |
| − | * [[RXN66-168]]
| + | |
| − | * [[RXN-10784]]
| + | |
| − | * [[2.4.1.225-RXN]]
| + | |
| − | * [[RXN66-162]]
| + | |
| − | == Reaction(s) known to produce the compound == | + | |
| − | * [[GLCUR1PUT]]
| + | |
| − | == Reaction(s) of unknown directionality ==
| + | |
| − | * [[2.7.7.44-RXN]]
| + | |
| − | * [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
| + | |
| | == External links == | | == External links == |
| − | * CAS : 2616-64-0
| + | {{#set: reaction associated=PROTEIN-KINASE-RXN}} |
| − | * METABOLIGHTS : MTBLC58052
| + | |
| − | * PUBCHEM:
| + | |
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202620 25202620]
| + | |
| − | * HMDB : HMDB00935
| + | |
| − | * LIGAND-CPD:
| + | |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?C00167 C00167]
| + | |
| − | * CHEBI:
| + | |
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58052 58052]
| + | |
| − | * BIGG : udpglcur
| + | |
| − | {{#set: smiles=C(C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))OP(=O)([O-])OP(=O)([O-])OC3(OC(C([O-])=O)C(O)C(O)C(O)3)}} | + | |
| − | {{#set: inchi key=InChIKey=HDYANYHVCAPMJV-LXQIFKJMSA-K}}
| + | |
| − | {{#set: common name=UDP-α-D-glucuronate}}
| + | |
| − | {{#set: molecular weight=577.265 }}
| + | |
| − | {{#set: common name=(UDP-GlcA)1|UDP-D-glucuronic acid|UDP-glucuronic acid|udp-glcua|UDP-glucuronate|uridine diphosphate glucuronate|uridine diphosphate glucuronic acid|UDP-D-glucuronate}}
| + | |
| − | {{#set: consumed by=RXN-14361|UDP-GLUCURONATE-DECARBOXYLASE-RXN|RXN-9000|RXN-10618|RXN-10619|RXN-10616|RXN-10617|RXN-11060|RXN66-83|UGDC|UDP-GLUCURONOSYLTRANSFERASE-RXN|RXN-13608|RXN-10609|RXN-10608|RXN-10607|RXN-10606|RXN-13607|2.4.1.135-RXN|RXN66-168|RXN-10784|2.4.1.225-RXN|RXN66-162}}
| + | |
| − | {{#set: produced by=GLCUR1PUT}}
| + | |
| − | {{#set: consumed or produced by=2.7.7.44-RXN|UDP-GLUCURONATE-4-EPIMERASE-RXN}}
| + | |
