Difference between revisions of "RXN-8988"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE] == * smiles: ** C([N...")
(Created page with "Category:Gene == Gene Tiso_gene_14025 == * left end position: ** 245 * transcription direction: ** POSITIVE * right end position: ** 1272 * centisome position: ** 4.158180...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE] ==
+
== Gene Tiso_gene_14025 ==
* smiles:
+
* left end position:
** C([N+])COP([O-])(=O)OCC(O)CO[R]
+
** 245
* common name:
+
* transcription direction:
** 1-alkyl-sn-glycero-3-phosphoethanolamine
+
** POSITIVE
 +
* right end position:
 +
** 1272
 +
* centisome position:
 +
** 4.1581807   
 
* Synonym(s):
 
* Synonym(s):
** 1-alkyl-2-lysosnn-glycero-3-phosphoethanolamine
 
** 1-radyl-2-lyso-sn-glycero-3-phosphoethanolamine
 
** 1-organyl-2-lyso-sn-glycero-3-phosphoethanolamine
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
* [[LPLPS1AGPE180]]
+
** in-silico_annotation
== Reaction(s) of unknown directionality ==
+
***automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: left end position=245}}
** [http://www.genome.jp/dbget-bin/www_bget?C04476 C04476]
+
{{#set: transcription direction=POSITIVE}}
* CHEBI:
+
{{#set: right end position=1272}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18244 18244]
+
{{#set: centisome position=4.1581807    }}
{{#set: smiles=C([N+])COP([O-])(=O)OCC(O)CO[R]}}
+
{{#set: reaction associated=DNA-DIRECTED-RNA-POLYMERASE-RXN}}
{{#set: common name=1-alkyl-sn-glycero-3-phosphoethanolamine}}
+
{{#set: common name=1-alkyl-2-lysosnn-glycero-3-phosphoethanolamine|1-radyl-2-lyso-sn-glycero-3-phosphoethanolamine|1-organyl-2-lyso-sn-glycero-3-phosphoethanolamine}}
+
{{#set: produced by=LPLPS1AGPE180}}
+

Revision as of 00:08, 19 March 2018

Gene Tiso_gene_14025

  • left end position:
    • 245
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1272
  • centisome position:
    • 4.1581807
  • Synonym(s):

Reactions associated

Pathways associated

External links