Difference between revisions of "PWY-5151"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINATE_NUCLEOTIDE NICOTINATE_NUCLEOTIDE] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O1...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12398 RXN-12398] == * direction: ** LEFT-TO-RIGHT * common name: ** xyloglucan XXLG oligosaccha...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINATE_NUCLEOTIDE NICOTINATE_NUCLEOTIDE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12398 RXN-12398] ==
−
* smiles:
+
* direction:
−
** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)[O-])C=2))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=JOUIQRNQJGXQDC-ZYUZMQFOSA-L
+
 
* common name:
 
* common name:
−
** β-nicotinate D-ribonucleotide
+
** xyloglucan XXLG oligosaccharide β-galactosidase
−
* molecular weight:
+
** glycoside_hydrolase
−
** 333.191   
+
** polyprotein
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/3.2.1.23 EC-3.2.1.23]
 
* Synonym(s):
 
* Synonym(s):
−
** nicotinate dinucleotide
 
−
** β-nicotinate-D-nucleotide
 
−
** NaMN
 
−
** nicotinic acid nucleotide
 
−
** nicotinic acid mononucleotide
 
−
** nicotinic acid ribonucleotide
 
−
** nicotinate-D-ribonucleotide
 
−
** nicotinate ribonucleotide
 
−
** nicotinate nucleotide
 
−
** deamido-nicotinamide mononucleotide
 
−
** deamido-NMN
 
−
** nicotinate D-ribonucleotide
 
−
** nicotinate mononucleotide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[NICONUCADENYLYLTRAN-RXN]]
+
* With identifiers:
−
* [[RXN-14227]]
+
** 1 [[CPD-13376]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-13375]][c] '''+''' 1 [[D-galactopyranose]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[RXN-8443]]
+
** 1 XXLG xyloglucan oligosaccharide[c] '''+''' 1 H2O[c] '''=>''' 1 XXXG xyloglucan oligosaccharide[c] '''+''' 1 D-galactopyranose[c]
−
* [[DNNH]]
+
 
−
* [[QUINOPRIBOTRANS-RXN]]
+
== Genes associated with this reaction  ==
−
== Reaction(s) of unknown directionality ==
+
Genes have been associated with this reaction based on different elements listed below.
−
* [[NRPH]]
+
* Gene: [[Tiso_gene_12839]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_1398]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_17558]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6807]], xyloglucan degradation II (exoglucanase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6807 PWY-6807]
 +
** '''3''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 321-02-8
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* METABOLIGHTS : MTBLC57502
+
{{#set: common name=xyloglucan XXLG oligosaccharide β-galactosidase}}
−
* PUBCHEM:
+
{{#set: common name=glycoside_hydrolase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878382 46878382]
+
{{#set: common name=polyprotein}}
−
* HMDB : HMDB01132
+
{{#set: ec number=EC-3.2.1.23}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_12839|Tiso_gene_1398|Tiso_gene_17558}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01185 C01185]
+
{{#set: in pathway=PWY-6807}}
−
* CHEBI:
+
{{#set: reconstruction category=orthology|annotation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57502 57502]
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
−
* BIGG : nicrnt
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: smiles=C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)[O-])C=2))}}
+
−
{{#set: inchi key=InChIKey=JOUIQRNQJGXQDC-ZYUZMQFOSA-L}}
+
−
{{#set: common name=β-nicotinate D-ribonucleotide}}
+
−
{{#set: molecular weight=333.191    }}
+
−
{{#set: common name=nicotinate dinucleotide|β-nicotinate-D-nucleotide|NaMN|nicotinic acid nucleotide|nicotinic acid mononucleotide|nicotinic acid ribonucleotide|nicotinate-D-ribonucleotide|nicotinate ribonucleotide|nicotinate nucleotide|deamido-nicotinamide mononucleotide|deamido-NMN|nicotinate D-ribonucleotide|nicotinate mononucleotide}}
+
−
{{#set: consumed by=NICONUCADENYLYLTRAN-RXN|RXN-14227}}
+
−
{{#set: produced by=RXN-8443|DNNH|QUINOPRIBOTRANS-RXN}}
+
−
{{#set: reversible reaction associated=NRPH}}
+

Revision as of 14:44, 21 March 2018

Reaction RXN-12398

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • xyloglucan XXLG oligosaccharide β-galactosidase
    • glycoside_hydrolase
    • polyprotein
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 XXLG xyloglucan oligosaccharide[c] + 1 H2O[c] => 1 XXXG xyloglucan oligosaccharide[c] + 1 D-galactopyranose[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6807, xyloglucan degradation II (exoglucanase): PWY-6807
    • 3 reactions found over 6 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-5151&oldid=29871"