Difference between revisions of "PHOSPHAGLYPSYN-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10330 CPD-10330] == * smiles: ** C(C1(C(C(C(O1)O)O)O))O * inchi key: ** InChIKey=HMFHBZSHGG...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14349 RXN-14349] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10330 CPD-10330] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14349 RXN-14349] ==
* smiles:
+
* direction:
** C(C1(C(C(C(O1)O)O)O))O
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N
+
* common name:
+
** α-D-ribofuranose
+
* molecular weight:
+
** 150.131   
+
 
* Synonym(s):
 
* Synonym(s):
** α D-ribose
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RIBOKIN-RXN]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[WATER]][c] '''+''' 1.0 [[MALTOSE]][c] '''=>''' 1.0 [[ALPHA-GLUCOSE]][c] '''+''' 1.0 [[GLC]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
* [[RXN-14904]]
+
** 1.0 H2O[c] '''+''' 1.0 maltose[c] '''=>''' 1.0 α-D-glucopyranose[c] '''+''' 1.0 β-D-glucopyranose[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_4952]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_4953]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=445894 445894]
+
{{#set: gene associated=Tiso_gene_4952|Tiso_gene_4953}}
* CHEMSPIDER:
+
{{#set: in pathway=}}
** [http://www.chemspider.com/Chemical-Structure.5575.html 5575]
+
{{#set: reconstruction category=orthology}}
* CHEBI:
+
{{#set: reconstruction source=orthology-esiliculosus}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=45506 45506]
+
{{#set: reconstruction tool=pantograph}}
* HMDB : HMDB00283
+
{{#set: smiles=C(C1(C(C(C(O1)O)O)O))O}}
+
{{#set: inchi key=InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N}}
+
{{#set: common name=α-D-ribofuranose}}
+
{{#set: molecular weight=150.131    }}
+
{{#set: common name=α D-ribose}}
+
{{#set: consumed by=RIBOKIN-RXN}}
+
{{#set: reversible reaction associated=RXN-14904}}
+

Revision as of 14:45, 21 March 2018

Reaction RXN-14349

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 H2O[c] + 1.0 maltose[c] => 1.0 α-D-glucopyranose[c] + 1.0 β-D-glucopyranose[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links