Difference between revisions of "CPD-7031"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYISOURATE 5-HYDROXYISOURATE] == * smiles: ** C2(C1(O)(NC(=O)NC1=NC(=O)N2))(=O) * inchi...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7570 PWY-7570] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7570 PWY-7570] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** blasticidin S biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''10''' reactions in the full pathway |
| − | == Reaction(s) | + | * [[RXN-14065]] |
| − | == | + | ** 2 associated gene(s): |
| + | *** [[Tiso_gene_11910]] | ||
| + | *** [[Tiso_gene_12995]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15927 RXN-15927] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15928 RXN-15928] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15929 RXN-15929] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15930 RXN-15930] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15935 RXN-15935] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15936 RXN-15936] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15937 RXN-15937] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15938 RXN-15938] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15939 RXN-15939] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=blasticidin S biosynthesis}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=10}} | |
| − | + | {{#set: completion rate=10.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 14:45, 21 March 2018
Pathway PWY-7570
- taxonomic range:
- common name:
- blasticidin S biosynthesis
- Synonym(s):
Reaction(s) found
1 reactions found over 10 reactions in the full pathway
- RXN-14065
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
