Difference between revisions of "Tiso gene 10501"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_6621 == * Synonym(s): == Reactions associated == * RXN-1882 ** pantograph-athaliana ** pantograph-esiliculosus * RXN...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-RIBAZOLE-5-P ALPHA-RIBAZOLE-5-P] == * smiles: ** CC2(C(C)=CC1(N(C=NC=1C=2)C3(C(O)C(O)C(CO...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-RIBAZOLE-5-P ALPHA-RIBAZOLE-5-P] == |
+ | * smiles: | ||
+ | ** CC2(C(C)=CC1(N(C=NC=1C=2)C3(C(O)C(O)C(COP([O-])(=O)[O-])O3))) | ||
+ | * common name: | ||
+ | ** α-ribazole 5'-phosphate | ||
+ | * inchi key: | ||
+ | ** InChIKey=ZMRGXEJKZPRBPJ-SYQHCUMBSA-L | ||
+ | * molecular weight: | ||
+ | ** 356.271 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** N1-(5'-phospho-α-D-ribosyl)-5,6-dimethylbenzimidazole | ||
+ | ** DMB-ribose-5'-P | ||
+ | ** α-ribazole-5'-P | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RIBAZOLEPHOSPHAT-RXN]] |
− | + | * [[R04594]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-16788]] | |
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04778 C04778] |
+ | * HMDB : HMDB03882 | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57918 57918] | ||
+ | * BIGG : 5prdmbz | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791947 49791947] | ||
+ | {{#set: smiles=CC2(C(C)=CC1(N(C=NC=1C=2)C3(C(O)C(O)C(COP([O-])(=O)[O-])O3)))}} | ||
+ | {{#set: common name=α-ribazole 5'-phosphate}} | ||
+ | {{#set: inchi key=InChIKey=ZMRGXEJKZPRBPJ-SYQHCUMBSA-L}} | ||
+ | {{#set: molecular weight=356.271 }} | ||
+ | {{#set: common name=N1-(5'-phospho-α-D-ribosyl)-5,6-dimethylbenzimidazole|DMB-ribose-5'-P|α-ribazole-5'-P}} | ||
+ | {{#set: consumed by=RIBAZOLEPHOSPHAT-RXN|R04594}} | ||
+ | {{#set: reversible reaction associated=RXN-16788}} |
Revision as of 14:48, 21 March 2018
Contents
Metabolite ALPHA-RIBAZOLE-5-P
- smiles:
- CC2(C(C)=CC1(N(C=NC=1C=2)C3(C(O)C(O)C(COP([O-])(=O)[O-])O3)))
- common name:
- α-ribazole 5'-phosphate
- inchi key:
- InChIKey=ZMRGXEJKZPRBPJ-SYQHCUMBSA-L
- molecular weight:
- 356.271
- Synonym(s):
- N1-(5'-phospho-α-D-ribosyl)-5,6-dimethylbenzimidazole
- DMB-ribose-5'-P
- α-ribazole-5'-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC2(C(C)=CC1(N(C=NC=1C=2)C3(C(O)C(O)C(COP([O-])(=O)[O-])O3)))" cannot be used as a page name in this wiki.