Difference between revisions of "PWY-5314"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5344 PWY-5344] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11876 CPD-11876] == * smiles: ** COC1(=C(O)C=CC(C(O)C=O)=C1) * common name: ** 3-methoxy-4-...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5344 PWY-5344] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11876 CPD-11876] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
** COC1(=C(O)C=CC(C(O)C=O)=C1)
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
 
* common name:
 
* common name:
−
** L-homocysteine biosynthesis
+
** 3-methoxy-4-hydroxyphenylglycolaldehyde
 +
* inchi key:
 +
** InChIKey=VISAJVAPYPFKCL-QMMMGPOBSA-N
 +
* molecular weight:
 +
** 182.176   
 
* Synonym(s):
 
* Synonym(s):
 +
** MOPEGAL
 +
** 4-hydroxy-3-methoxymandelaldehyde
 +
** 3-methoxy 4-hydroxy mandelic aldehyde
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''2''' reactions found over '''2''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[ACETYLHOMOSER-CYS-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** 1 associated gene(s):
+
* [[RXN-10915]]
−
*** [[Tiso_gene_3732]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[orthology-creinhardtii]]
+
−
* [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]]
+
−
** 1 associated gene(s):
+
−
*** [[Tiso_gene_5558]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-4751}}
+
* PUBCHEM:
−
{{#set: taxonomic range=TAX-2}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658114 90658114]
−
{{#set: common name=L-homocysteine biosynthesis}}
+
* CHEMSPIDER:
−
{{#set: reaction found=2}}
+
** [http://www.chemspider.com/Chemical-Structure.389601.html 389601]
−
{{#set: total reaction=2}}
+
* HMDB : HMDB04061
−
{{#set: completion rate=100.0}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C05583 C05583]
 +
{{#set: smiles=COC1(=C(O)C=CC(C(O)C=O)=C1)}}
 +
{{#set: common name=3-methoxy-4-hydroxyphenylglycolaldehyde}}
 +
{{#set: inchi key=InChIKey=VISAJVAPYPFKCL-QMMMGPOBSA-N}}
 +
{{#set: molecular weight=182.176    }}
 +
{{#set: common name=MOPEGAL|4-hydroxy-3-methoxymandelaldehyde|3-methoxy 4-hydroxy mandelic aldehyde}}
 +
{{#set: reversible reaction associated=RXN-10915}}

Revision as of 14:48, 21 March 2018

Metabolite CPD-11876

  • smiles:
    • COC1(=C(O)C=CC(C(O)C=O)=C1)
  • common name:
    • 3-methoxy-4-hydroxyphenylglycolaldehyde
  • inchi key:
    • InChIKey=VISAJVAPYPFKCL-QMMMGPOBSA-N
  • molecular weight:
    • 182.176
  • Synonym(s):
    • MOPEGAL
    • 4-hydroxy-3-methoxymandelaldehyde
    • 3-methoxy 4-hydroxy mandelic aldehyde

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-5314&oldid=30338"