Difference between revisions of "Tiso gene 18831"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_2527 == * left end position: ** 6449 * transcription direction: ** POSITIVE * right end position: ** 7885 * centisome position: ** 33.84946...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11400 CPD-11400] == * smiles: ** C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=CC(OC2(OC(C(=...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11400 CPD-11400] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=CC(OC2(OC(C(=O)[O-])C(O)C(O)C(O)2))=C(I)C=3)) |
| − | * | + | * common name: |
| − | ** | + | ** 3,5,3'-triiodo-L-thyronine phenolic β-D-glucuronide |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=YYFGGGCINNGOLE-ZDXOGFQLSA-M |
| − | * | + | * molecular weight: |
| − | ** | + | ** 826.095 |
* Synonym(s): | * Synonym(s): | ||
| + | ** triiodothyronine glucuronide | ||
| + | ** beta-D-glucopyranosiduronic acid, 4-(4-(2-amino-2-carboxyethyl)-2,6-diiodophenoxy)-2-iodophenyl, (S)- | ||
| + | ** T3G | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-10607]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | * [[RXN- | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659063 90659063] |
| − | {{#set: | + | {{#set: smiles=C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=CC(OC2(OC(C(=O)[O-])C(O)C(O)C(O)2))=C(I)C=3))}} |
| − | {{#set: | + | {{#set: common name=3,5,3'-triiodo-L-thyronine phenolic β-D-glucuronide}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=YYFGGGCINNGOLE-ZDXOGFQLSA-M}} |
| − | {{#set: | + | {{#set: molecular weight=826.095 }} |
| + | {{#set: common name=triiodothyronine glucuronide|beta-D-glucopyranosiduronic acid, 4-(4-(2-amino-2-carboxyethyl)-2,6-diiodophenoxy)-2-iodophenyl, (S)-|T3G}} | ||
| + | {{#set: produced by=RXN-10607}} | ||
Revision as of 14:48, 21 March 2018
Contents
Metabolite CPD-11400
- smiles:
- C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=CC(OC2(OC(C(=O)[O-])C(O)C(O)C(O)2))=C(I)C=3))
- common name:
- 3,5,3'-triiodo-L-thyronine phenolic β-D-glucuronide
- inchi key:
- InChIKey=YYFGGGCINNGOLE-ZDXOGFQLSA-M
- molecular weight:
- 826.095
- Synonym(s):
- triiodothyronine glucuronide
- beta-D-glucopyranosiduronic acid, 4-(4-(2-amino-2-carboxyethyl)-2,6-diiodophenoxy)-2-iodophenyl, (S)-
- T3G
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=CC(OC2(OC(C(=O)[O-])C(O)C(O)C(O)2))=C(I)C=3))" cannot be used as a page name in this wiki.
