Difference between revisions of "Tiso gene 12191"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE] == * smiles: **...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5945 PWY-5945] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5945 PWY-5945] ==
−
* smiles:
+
* taxonomic range:
−
** C[S+](CCC(C([O-])=O)=O)CC1(OC(C(C1O)O)N3(C2(=NC=NC(=C2N=C3)N)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2763 TAX-2763]
−
** InChIKey=UOKVQQMBGVMXPU-CJPDYEHRSA-N
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 
* common name:
 
* common name:
−
** S-adenosyl-4-methylthio-2-oxobutanoate
+
** zeaxanthin, antheraxanthin and violaxanthin interconversion
−
* molecular weight:
+
−
** 397.405   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** xanthophyll cycle
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''4''' reactions found over '''4''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[RXN-7978]]
−
* [[DAPASYN-RXN]]
+
** 2 associated gene(s):
 +
*** [[Tiso_gene_6386]]
 +
*** [[Tiso_gene_10919]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-7979]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_10919]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-7984]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_16523]]
 +
*** [[Tiso_gene_1275]]
 +
*** [[Tiso_gene_5666]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-7985]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_5666]]
 +
*** [[Tiso_gene_1275]]
 +
*** [[Tiso_gene_16523]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4751}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459852 5459852]
+
{{#set: taxonomic range=TAX-2763}}
−
* CHEMSPIDER:
+
{{#set: taxonomic range=TAX-1117}}
−
** [http://www.chemspider.com/Chemical-Structure.4573603.html 4573603]
+
{{#set: taxonomic range=TAX-33090}}
−
* CHEBI:
+
{{#set: common name=zeaxanthin, antheraxanthin and violaxanthin interconversion}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16490 16490]
+
{{#set: common name=xanthophyll cycle}}
−
* BIGG : amob
+
{{#set: reaction found=4}}
−
* LIGAND-CPD:
+
{{#set: total reaction=4}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04425 C04425]
+
{{#set: completion rate=100.0}}
−
{{#set: smiles=C[S+](CCC(C([O-])=O)=O)CC1(OC(C(C1O)O)N3(C2(=NC=NC(=C2N=C3)N)))}}
+
−
{{#set: inchi key=InChIKey=UOKVQQMBGVMXPU-CJPDYEHRSA-N}}
+
−
{{#set: common name=S-adenosyl-4-methylthio-2-oxobutanoate}}
+
−
{{#set: molecular weight=397.405    }}
+
−
{{#set: reversible reaction associated=DAPASYN-RXN}}
+

Revision as of 14:57, 21 March 2018

Pathway PWY-5945

Reaction(s) found

4 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_12191&oldid=31422"