Difference between revisions of "DIHYDRO-DIOH-BENZOATE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_567 == * left end position: ** 12224 * transcription direction: ** POSITIVE * right end position: ** 14178 * centisome position: ** 38.8458...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-TAGATURONATE D-TAGATURONATE] == * smiles: ** C(O)C(=O)C(O)C(O)C(O)C(=O)[O-] * common name: **...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-TAGATURONATE D-TAGATURONATE] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(O)C(=O)C(O)C(O)C(O)C(=O)[O-] |
| − | * | + | * common name: |
| − | ** | + | ** D-tagaturonate |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=IZSRJDGCGRAUAR-WDCZJNDASA-M |
| − | * | + | * molecular weight: |
| − | ** | + | ** 193.133 |
* Synonym(s): | * Synonym(s): | ||
| + | ** tagaturonate | ||
| + | ** D-arabino-hex-5-ulosonate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[GALACTUROISOM-RXN]] | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460108 5460108] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.4573770.html 4573770] |
| − | {{#set: reaction associated= | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17886 17886] | ||
| + | * BIGG : tagur | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00558 C00558] | ||
| + | {{#set: smiles=C(O)C(=O)C(O)C(O)C(O)C(=O)[O-]}} | ||
| + | {{#set: common name=D-tagaturonate}} | ||
| + | {{#set: inchi key=InChIKey=IZSRJDGCGRAUAR-WDCZJNDASA-M}} | ||
| + | {{#set: molecular weight=193.133 }} | ||
| + | {{#set: common name=tagaturonate|D-arabino-hex-5-ulosonate}} | ||
| + | {{#set: reversible reaction associated=GALACTUROISOM-RXN}} | ||
Revision as of 14:58, 21 March 2018
Contents
Metabolite D-TAGATURONATE
- smiles:
- C(O)C(=O)C(O)C(O)C(O)C(=O)[O-]
- common name:
- D-tagaturonate
- inchi key:
- InChIKey=IZSRJDGCGRAUAR-WDCZJNDASA-M
- molecular weight:
- 193.133
- Synonym(s):
- tagaturonate
- D-arabino-hex-5-ulosonate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C(=O)C(O)C(O)C(O)C(=O)[O-" cannot be used as a page name in this wiki.
