Difference between revisions of "RXN-14503"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_12989 == * left end position: ** 18 * transcription direction: ** POSITIVE * right end position: ** 4670 * centisome position: ** 0.1716083...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRISTANATE PRISTANATE] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C([O-])=O)C)C)C * common name: ** pr...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRISTANATE PRISTANATE] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(CCCC(CCCC(C)CCCC(C([O-])=O)C)C)C |
| − | * | + | * common name: |
| − | ** | + | ** pristanate |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=PAHGJZDQXIOYTH-UHFFFAOYSA-M |
| − | * | + | * molecular weight: |
| − | ** | + | ** 297.5 |
* Synonym(s): | * Synonym(s): | ||
| + | ** pristanic-acid | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN66-484]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=20849056 20849056] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.20171482.html 20171482] |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77268 77268] | ||
| + | {{#set: smiles=CC(CCCC(CCCC(C)CCCC(C([O-])=O)C)C)C}} | ||
| + | {{#set: common name=pristanate}} | ||
| + | {{#set: inchi key=InChIKey=PAHGJZDQXIOYTH-UHFFFAOYSA-M}} | ||
| + | {{#set: molecular weight=297.5 }} | ||
| + | {{#set: common name=pristanic-acid}} | ||
| + | {{#set: consumed by=RXN66-484}} | ||
Revision as of 15:04, 21 March 2018
Contents
Metabolite PRISTANATE
- smiles:
- CC(CCCC(CCCC(C)CCCC(C([O-])=O)C)C)C
- common name:
- pristanate
- inchi key:
- InChIKey=PAHGJZDQXIOYTH-UHFFFAOYSA-M
- molecular weight:
- 297.5
- Synonym(s):
- pristanic-acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(CCCC(CCCC(C)CCCC(C([O-])=O)C)C)C" cannot be used as a page name in this wiki.
