Difference between revisions of "Tiso gene 287"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PORPHOBILINOGEN PORPHOBILINOGEN] == * smiles: ** C(C1(=C(C(=CN1)CCC(=O)[O-])CC(=O)[O-]))[N+] *...") |
(Created page with "Category:Gene == Gene Tiso_gene_3052 == * right end position: ** 12016 * transcription direction: ** POSITIVE * left end position: ** 9007 * centisome position: ** 51.0427...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_3052 == |
− | * | + | * right end position: |
− | ** | + | ** 12016 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 9007 |
− | * | + | * centisome position: |
− | ** | + | ** 51.04273 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[3.1.3.66-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: ec-number |
− | == | + | * Reaction: [[RXN-10959]] |
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-10960]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6368]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=12016}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=9007}} | |
− | + | {{#set: centisome position=51.04273 }} | |
− | + | {{#set: reaction associated=3.1.3.66-RXN|RXN-10959|RXN-10960}} | |
− | + | {{#set: pathway associated=PWY-6368}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:07, 21 March 2018
Gene Tiso_gene_3052
- right end position:
- 12016
- transcription direction:
- POSITIVE
- left end position:
- 9007
- centisome position:
- 51.04273
- Synonym(s):
Reactions associated
- Reaction: 3.1.3.66-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-10959
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-10960
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation