Difference between revisions of "AMINOPARATHION-PHOSPHATASE-RXN"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-701 PWY-701] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19395 CPD-19395] == * smiles: ** C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O * common name:...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19395 CPD-19395] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O |
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** L- | + | ** γ-L-glutamyl-glycylglycine |
| + | * inchi key: | ||
| + | ** InChIKey=RWAZIEYJAWTKLB-YFKPBYRVSA-M | ||
| + | * molecular weight: | ||
| + | ** 260.226 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** γ-L-Glu-Gly-Gly | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-18092]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | * [[RXN- | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
== External links == | == External links == | ||
| − | + | {{#set: smiles=C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O}} | |
| − | + | {{#set: common name=γ-L-glutamyl-glycylglycine}} | |
| − | + | {{#set: inchi key=InChIKey=RWAZIEYJAWTKLB-YFKPBYRVSA-M}} | |
| − | {{#set: | + | {{#set: molecular weight=260.226 }} |
| − | {{#set: | + | {{#set: common name=γ-L-Glu-Gly-Gly}} |
| − | {{#set: | + | {{#set: produced by=RXN-18092}} |
| − | {{#set: common name=L- | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Revision as of 15:09, 21 March 2018
Contents
Metabolite CPD-19395
- smiles:
- C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O
- common name:
- γ-L-glutamyl-glycylglycine
- inchi key:
- InChIKey=RWAZIEYJAWTKLB-YFKPBYRVSA-M
- molecular weight:
- 260.226
- Synonym(s):
- γ-L-Glu-Gly-Gly
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O" cannot be used as a page name in this wiki.
