Difference between revisions of "NADPH-DEHYDROGENASE-FLAVIN-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UMP UMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)) * inchi key: *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7369 PWY-7369] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7369 PWY-7369] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
| − | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
* common name: | * common name: | ||
| − | ** | + | ** thiamine triphosphate metabolism |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** thiamin triphosphate metabolism |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''2''' reactions found over '''2''' reactions in the full pathway | |
| − | * [[RXN | + | * [[THIAMIN-DIPHOSPHATE-KINASE-RXN]] |
| − | * | + | ** 0 associated gene: |
| − | * | + | ** 1 reconstruction source(s) associated: |
| − | + | *** [[annotation-in-silico_annotation]] | |
| − | * | + | * [[THIAMIN-TRIPHOSPHATASE-RXN]] |
| − | * | + | ** 1 associated gene(s): |
| − | + | *** [[Tiso_gene_4013]] | |
| − | + | ** 1 reconstruction source(s) associated: | |
| − | * [[ | + | *** [[annotation-in-silico_annotation]] |
| − | * [[ | + | == Reaction(s) not found == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | * | + | |
| − | * | + | |
| − | * | + | |
| − | * | + | |
| − | * [[ | + | |
| − | * | + | |
| − | * | + | |
| − | * | + | |
| − | * [[ | + | |
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2759}} | |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: taxonomic range=TAX-4751}} | |
| − | + | {{#set: common name=thiamine triphosphate metabolism}} | |
| − | + | {{#set: common name=thiamin triphosphate metabolism}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=2}} | |
| − | + | {{#set: completion rate=100.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 15:10, 21 March 2018
Pathway PWY-7369
- taxonomic range:
- common name:
- thiamine triphosphate metabolism
- Synonym(s):
- thiamin triphosphate metabolism
Reaction(s) found
2 reactions found over 2 reactions in the full pathway
- THIAMIN-DIPHOSPHATE-KINASE-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- THIAMIN-TRIPHOSPHATASE-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
