Difference between revisions of "RXN-6384"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GALACTONO-1-4-LACTONE D-GALACTONO-1-4-LACTONE] == * smiles: ** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)...")
(Created page with "Category:Gene == Gene Tiso_gene_14333 == * right end position: ** 3175 * transcription direction: ** POSITIVE * left end position: ** 64 * centisome position: ** 1.120056...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GALACTONO-1-4-LACTONE D-GALACTONO-1-4-LACTONE] ==
+
== Gene Tiso_gene_14333 ==
* smiles:
+
* right end position:
** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)
+
** 3175
* inchi key:
+
* transcription direction:
** InChIKey=SXZYCXMUPBBULW-AIHAYLRMSA-N
+
** POSITIVE
* common name:
+
* left end position:
** D-galactono-1,4-lactone
+
** 64
* molecular weight:
+
* centisome position:
** 178.141    
+
** 1.120056    
 
* Synonym(s):
 
* Synonym(s):
** D-galactonate-γ-lactone
 
** galactono-γ-lactone
 
** D-galactonolactone
 
** D-galactono-γ-lactone
 
** D-galactonic acid γ-lactone
 
** γ-D-galactonolactone
 
** D-(-)-galactonic acid γ-lactone
 
** D-galactonic acid g-lactone
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[GALACTONOLACTONASE-RXN]]
+
* Reaction: [[5.99.1.2-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* CAS : 2782-07-2
+
{{#set: right end position=3175}}
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=97165 97165]
+
{{#set: left end position=64}}
* HMDB : HMDB02541
+
{{#set: centisome position=1.120056   }}
* LIGAND-CPD:
+
{{#set: reaction associated=5.99.1.2-RXN}}
** [http://www.genome.jp/dbget-bin/www_bget?C03383 C03383]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.92162.html 92162]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15895 15895]
+
{{#set: smiles=C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)}}
+
{{#set: inchi key=InChIKey=SXZYCXMUPBBULW-AIHAYLRMSA-N}}
+
{{#set: common name=D-galactono-1,4-lactone}}
+
{{#set: molecular weight=178.141   }}
+
{{#set: common name=D-galactonate-γ-lactone|galactono-γ-lactone|D-galactonolactone|D-galactono-γ-lactone|D-galactonic acid γ-lactone|γ-D-galactonolactone|D-(-)-galactonic acid γ-lactone|D-galactonic acid g-lactone}}
+
{{#set: consumed by=GALACTONOLACTONASE-RXN}}
+

Revision as of 15:14, 21 March 2018

Gene Tiso_gene_14333

  • right end position:
    • 3175
  • transcription direction:
    • POSITIVE
  • left end position:
    • 64
  • centisome position:
    • 1.120056
  • Synonym(s):

Reactions associated

Pathways associated

External links