Difference between revisions of "CPD-8608"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-GUANIDO-BUTYRAMIDE 4-GUANIDO-BUTYRAMIDE] == * smiles: ** C(NC(N)=[N+])CCC(=O)N * inchi key: *...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DNA-3-methyladenines DNA-3-methyladenines] == * common name: ** an N3-methyladenine in DNA * Sy...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-GUANIDO-BUTYRAMIDE 4-GUANIDO-BUTYRAMIDE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DNA-3-methyladenines DNA-3-methyladenines] ==
* smiles:
+
** C(NC(N)=[N+])CCC(=O)N
+
* inchi key:
+
** InChIKey=YHVFECVVGNXFKO-UHFFFAOYSA-O
+
 
* common name:
 
* common name:
** 4-guanidinobutyramide
+
** an N3-methyladenine in DNA
* molecular weight:
+
** 145.184   
+
 
* Synonym(s):
 
* Synonym(s):
** 4-guanidinobutanamide
+
** a DNA with N3-methyladenine
** 4-guanidobutanamide
+
** 4-guanido-butyramide
+
** γ-guanidinobutyramide
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GUANIDINOBUTANAMIDE-NH3-RXN]]
+
* [[RXN0-5189]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ARGININE-2-MONOOXYGENASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an N3-methyladenine in DNA}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243936 25243936]
+
{{#set: common name=a DNA with N3-methyladenine}}
* CHEBI:
+
{{#set: consumed by=RXN0-5189}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58365 58365]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C03078 C03078]
+
{{#set: smiles=C(NC(N)=[N+])CCC(=O)N}}
+
{{#set: inchi key=InChIKey=YHVFECVVGNXFKO-UHFFFAOYSA-O}}
+
{{#set: common name=4-guanidinobutyramide}}
+
{{#set: molecular weight=145.184    }}
+
{{#set: common name=4-guanidinobutanamide|4-guanidobutanamide|4-guanido-butyramide|γ-guanidinobutyramide}}
+
{{#set: consumed by=GUANIDINOBUTANAMIDE-NH3-RXN}}
+
{{#set: produced by=ARGININE-2-MONOOXYGENASE-RXN}}
+

Revision as of 15:17, 21 March 2018

Metabolite DNA-3-methyladenines

  • common name:
    • an N3-methyladenine in DNA
  • Synonym(s):
    • a DNA with N3-methyladenine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links