Difference between revisions of "NRPH"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_6980 == * Synonym(s): == Reactions associated == * 4-NITROPHENYLPHOSPHATASE-RXN ** pantograph-esiliculosus == Pathways associa...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARNOSINE CARNOSINE] == * smiles: ** C(CC(=O)NC(CC1(=CNC=N1))C([O-])=O)[N+] * common name: ** c...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARNOSINE CARNOSINE] == |
+ | * smiles: | ||
+ | ** C(CC(=O)NC(CC1(=CNC=N1))C([O-])=O)[N+] | ||
+ | * common name: | ||
+ | ** carnosine | ||
+ | * inchi key: | ||
+ | ** InChIKey=CQOVPNPJLQNMDC-ZETCQYMHSA-N | ||
+ | * molecular weight: | ||
+ | ** 226.235 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** ignotine | ||
+ | ** N-β-alanyl-L-histidine | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[CARNOSINE-SYNTHASE-RXN]] | |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00386 C00386] | ||
+ | * HMDB : HMDB00033 | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57485 57485] | ||
+ | * METABOLIGHTS : MTBLC15727 | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6992100 6992100] | ||
+ | {{#set: smiles=C(CC(=O)NC(CC1(=CNC=N1))C([O-])=O)[N+]}} | ||
+ | {{#set: common name=carnosine}} | ||
+ | {{#set: inchi key=InChIKey=CQOVPNPJLQNMDC-ZETCQYMHSA-N}} | ||
+ | {{#set: molecular weight=226.235 }} | ||
+ | {{#set: common name=ignotine|N-β-alanyl-L-histidine}} | ||
+ | {{#set: produced by=CARNOSINE-SYNTHASE-RXN}} |
Revision as of 15:18, 21 March 2018
Contents
Metabolite CARNOSINE
- smiles:
- C(CC(=O)NC(CC1(=CNC=N1))C([O-])=O)[N+]
- common name:
- carnosine
- inchi key:
- InChIKey=CQOVPNPJLQNMDC-ZETCQYMHSA-N
- molecular weight:
- 226.235
- Synonym(s):
- ignotine
- N-β-alanyl-L-histidine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CC(=O)NC(CC1(=CNC=N1))C([O-])=O)[N+" cannot be used as a page name in this wiki.