Difference between revisions of "Diacylglycerol-NNN-trimethylhomoserines"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7035 CPD-7035] == * smiles: ** C1(C=CC(CCO)=CC=1) * inchi key: ** InChIKey=WRMNZCZEMHIOCP-U...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7817 PWY-7817] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-12...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7035 CPD-7035] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7817 PWY-7817] ==
−
* smiles:
+
* taxonomic range:
−
** C1(C=CC(CCO)=CC=1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239]
−
* inchi key:
+
−
** InChIKey=WRMNZCZEMHIOCP-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** 2-phenylethanol
+
** type I lipoteichoic acid biosynthesis (S. aureus)
−
* molecular weight:
+
−
** 122.166   
+
 
* Synonym(s):
 
* Synonym(s):
−
** benzeneethanol
 
−
** phenethanol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''7''' reactions found over '''16''' reactions in the full pathway
−
* [[RXN-7700]]
+
* [[CDPDIGLYSYN-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
 +
*** [[Tiso_gene_3522]]
 +
*** [[Tiso_gene_2311]]
 +
*** [[Tiso_gene_3523]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[DIACYLGLYKIN-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_14560]]
 +
*** [[Tiso_gene_1163]]
 +
*** [[Tiso_gene_1420]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[GLUC1PURIDYLTRANS-RXN]]
 +
** 14 associated gene(s):
 +
*** [[Tiso_gene_6459]]
 +
*** [[Tiso_gene_4816]]
 +
*** [[Tiso_gene_17531]]
 +
*** [[Tiso_gene_5879]]
 +
*** [[Tiso_gene_17566]]
 +
*** [[Tiso_gene_16930]]
 +
*** [[Tiso_gene_14796]]
 +
*** [[Tiso_gene_9110]]
 +
*** [[Tiso_gene_13477]]
 +
*** [[Tiso_gene_7440]]
 +
*** [[Tiso_gene_11401]]
 +
*** [[Tiso_gene_6457]]
 +
*** [[Tiso_gene_6458]]
 +
*** [[Tiso_gene_7102]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[PGPPHOSPHA-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_18092]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[PHOSPHAGLYPSYN-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-15117]]
 +
** 12 associated gene(s):
 +
*** [[Tiso_gene_3385]]
 +
*** [[Tiso_gene_412]]
 +
*** [[Tiso_gene_15372]]
 +
*** [[Tiso_gene_12341]]
 +
*** [[Tiso_gene_19034]]
 +
*** [[Tiso_gene_10734]]
 +
*** [[Tiso_gene_7966]]
 +
*** [[Tiso_gene_9428]]
 +
*** [[Tiso_gene_15050]]
 +
*** [[Tiso_gene_11792]]
 +
*** [[Tiso_gene_17894]]
 +
*** [[Tiso_gene_10863]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
* [[RXN-16648]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_6390]]
 +
*** [[Tiso_gene_322]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-synechocystis]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-18013 RXN-18013]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-18014 RXN-18014]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-18035 RXN-18035]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-18036 RXN-18036]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-18037 RXN-18037]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-18038 RXN-18038]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-18039 RXN-18039]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN-315 TRANS-RXN-315]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN-316 TRANS-RXN-316]
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB02192
+
{{#set: taxonomic range=TAX-1239}}
−
* PUBCHEM:
+
{{#set: common name=type I lipoteichoic acid biosynthesis (S. aureus)}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6054 6054]
+
{{#set: reaction found=7}}
−
* HMDB : HMDB33944
+
{{#set: total reaction=16}}
−
* LIGAND-CPD:
+
{{#set: completion rate=44.0}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05853 C05853]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.5830.html 5830]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=49000 49000]
+
−
* METABOLIGHTS : MTBLC49000
+
−
{{#set: smiles=C1(C=CC(CCO)=CC=1)}}
+
−
{{#set: inchi key=InChIKey=WRMNZCZEMHIOCP-UHFFFAOYSA-N}}
+
−
{{#set: common name=2-phenylethanol}}
+
−
{{#set: molecular weight=122.166    }}
+
−
{{#set: common name=benzeneethanol|phenethanol}}
+
−
{{#set: produced by=RXN-7700}}
+

Revision as of 15:22, 21 March 2018

Pathway PWY-7817

  • taxonomic range:
  • common name:
    • type I lipoteichoic acid biosynthesis (S. aureus)
  • Synonym(s):

Reaction(s) found

7 reactions found over 16 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Diacylglycerol-NNN-trimethylhomoserines&oldid=33798"