Difference between revisions of "PWY-5526"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_12761 == * left end position: ** 2865 * transcription direction: ** POSITIVE * right end position: ** 4311 * centisome position: ** 19.5336...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13559 CPD-13559] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O)O1) * common name: ** α-D-man...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13559 CPD-13559] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(O)C1(C(O)C(O)C(O)C(O)O1) |
| − | * | + | * common name: |
| − | ** | + | ** α-D-mannopyranose |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=WQZGKKKJIJFFOK-PQMKYFCFSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 180.157 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[2 | + | == Reaction(s) known to produce the compound == |
| − | + | * [[3.2.1.24-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=185698 185698] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28729 28729] |
| − | {{#set: | + | * METABOLIGHTS : MTBLC28729 |
| − | + | * LIGAND-CPD: | |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00936 C00936] | ||
| + | {{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O)O1)}} | ||
| + | {{#set: common name=α-D-mannopyranose}} | ||
| + | {{#set: inchi key=InChIKey=WQZGKKKJIJFFOK-PQMKYFCFSA-N}} | ||
| + | {{#set: molecular weight=180.157 }} | ||
| + | {{#set: produced by=3.2.1.24-RXN}} | ||
Revision as of 15:24, 21 March 2018
Contents
Metabolite CPD-13559
- smiles:
- C(O)C1(C(O)C(O)C(O)C(O)O1)
- common name:
- α-D-mannopyranose
- inchi key:
- InChIKey=WQZGKKKJIJFFOK-PQMKYFCFSA-N
- molecular weight:
- 180.157
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
