Difference between revisions of "PWY-7344"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7562 PWY-7562] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11756 CPD-11756] == * smiles: ** C1(C=C(C5(=C(C=1)C4(C2(C(NC(C=2C6(C3(C=CC=C(C=3N(C(C=4N5)=...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11756 CPD-11756] == |
− | * | + | * smiles: |
− | ** | + | ** C1(C=C(C5(=C(C=1)C4(C2(C(NC(C=2C6(C3(C=CC=C(C=3N(C(C=4N5)=6)C7(C(C(C(C(CO)O7)O)O)O))Cl)))=O)=O))))Cl) |
* common name: | * common name: | ||
− | ** | + | ** 4'-O-demethylrebeccamycin |
+ | * inchi key: | ||
+ | ** InChIKey=NNPBOGAWNUIKAO-RJZBGXQMSA-N | ||
+ | * molecular weight: | ||
+ | ** 556.358 | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-10847]] | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C19700 C19700] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=595389 595389] |
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45259192 45259192] | ||
+ | {{#set: smiles=C1(C=C(C5(=C(C=1)C4(C2(C(NC(C=2C6(C3(C=CC=C(C=3N(C(C=4N5)=6)C7(C(C(C(C(CO)O7)O)O)O))Cl)))=O)=O))))Cl)}} | ||
+ | {{#set: common name=4'-O-demethylrebeccamycin}} | ||
+ | {{#set: inchi key=InChIKey=NNPBOGAWNUIKAO-RJZBGXQMSA-N}} | ||
+ | {{#set: molecular weight=556.358 }} | ||
+ | {{#set: consumed by=RXN-10847}} |
Revision as of 15:26, 21 March 2018
Contents
Metabolite CPD-11756
- smiles:
- C1(C=C(C5(=C(C=1)C4(C2(C(NC(C=2C6(C3(C=CC=C(C=3N(C(C=4N5)=6)C7(C(C(C(C(CO)O7)O)O)O))Cl)))=O)=O))))Cl)
- common name:
- 4'-O-demethylrebeccamycin
- inchi key:
- InChIKey=NNPBOGAWNUIKAO-RJZBGXQMSA-N
- molecular weight:
- 556.358
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links