Difference between revisions of "P42-PWY"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATPPHOSPHORIBOSYLTRANS-RXN ATPPHOSPHORIBOSYLTRANS-RXN] == * direction: ** REVERSIBLE * ec number: *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14420 CPD-14420] == * smiles: ** CCC=CCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)CO...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14420 CPD-14420] == |
− | * | + | * smiles: |
− | ** | + | ** CCC=CCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
− | * | + | * common name: |
− | ** | + | ** icosatrienoyl-2-enoyl CoA |
+ | * inchi key: | ||
+ | ** InChIKey=YJKOIKYLHSMLHC-ATRRWJJYSA-J | ||
+ | * molecular weight: | ||
+ | ** 1049.959 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 18:3Δ9,12,15 | ||
+ | ** (9Z,12Z,15Z)-octadecatrienoyl-CoA | ||
+ | ** eicosatrienoyl-2-enoyl CoA | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-12997]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-13001]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72551551 72551551] |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76456 76456] |
− | + | {{#set: smiles=CCC=CCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | |
− | + | {{#set: common name=icosatrienoyl-2-enoyl CoA}} | |
− | + | {{#set: inchi key=InChIKey=YJKOIKYLHSMLHC-ATRRWJJYSA-J}} | |
− | + | {{#set: molecular weight=1049.959 }} | |
− | + | {{#set: common name=18:3Δ9,12,15|(9Z,12Z,15Z)-octadecatrienoyl-CoA|eicosatrienoyl-2-enoyl CoA}} | |
− | + | {{#set: consumed by=RXN-12997}} | |
− | + | {{#set: produced by=RXN-13001}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:27, 21 March 2018
Contents
Metabolite CPD-14420
- smiles:
- CCC=CCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- icosatrienoyl-2-enoyl CoA
- inchi key:
- InChIKey=YJKOIKYLHSMLHC-ATRRWJJYSA-J
- molecular weight:
- 1049.959
- Synonym(s):
- 18:3Δ9,12,15
- (9Z,12Z,15Z)-octadecatrienoyl-CoA
- eicosatrienoyl-2-enoyl CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.