Difference between revisions of "Tiso gene 2777"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2723 PWY-2723] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] == * smiles: ** C1(C(O)CC(=NC1C([O-])=O)C([O-])=O) * common name: ** (2S,4...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2723 PWY-2723] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
** C1(C(O)CC(=NC1C([O-])=O)C([O-])=O)
 
* common name:
 
* common name:
−
** trehalose degradation V
+
** (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate
 +
* inchi key:
 +
** InChIKey=DVTPRYHENFBCII-IMJSIDKUSA-L
 +
* molecular weight:
 +
** 185.136   
 
* Synonym(s):
 
* Synonym(s):
 +
** (4S)-4-hydroxy-2,3,4,5-tetrahydro-(2S)-dipicolinate
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''2''' reactions found over '''3''' reactions in the full pathway
+
* [[RXN-14014]]
−
* [[GLUCOKIN-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** 2 associated gene(s):
+
* [[DIHYDRODIPICSYN-RXN]]
−
*** [[Tiso_gene_3107]]
+
== Reaction(s) of unknown directionality ==
−
*** [[Tiso_gene_1303]]
+
−
** 4 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-synechocystis]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[PHOSPHOGLUCMUT-RXN]]
+
−
** 2 associated gene(s):
+
−
*** [[Tiso_gene_13477]]
+
−
*** [[Tiso_gene_4816]]
+
−
** 3 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[manual-primary_network]]
+
−
*** [[annotation-experimental_annotation]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-4441 RXN-4441]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-4751}}
+
* PUBCHEM:
−
{{#set: common name=trehalose degradation V}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678847 70678847]
−
{{#set: reaction found=2}}
+
* CHEBI:
−
{{#set: total reaction=3}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=67139 67139]
−
{{#set: completion rate=67.0}}
+
{{#set: smiles=C1(C(O)CC(=NC1C([O-])=O)C([O-])=O)}}
 +
{{#set: common name=(2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate}}
 +
{{#set: inchi key=InChIKey=DVTPRYHENFBCII-IMJSIDKUSA-L}}
 +
{{#set: molecular weight=185.136    }}
 +
{{#set: common name=(4S)-4-hydroxy-2,3,4,5-tetrahydro-(2S)-dipicolinate}}
 +
{{#set: consumed by=RXN-14014}}
 +
{{#set: produced by=DIHYDRODIPICSYN-RXN}}

Revision as of 15:30, 21 March 2018

Metabolite CPD-14443

  • smiles:
    • C1(C(O)CC(=NC1C([O-])=O)C([O-])=O)
  • common name:
    • (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate
  • inchi key:
    • InChIKey=DVTPRYHENFBCII-IMJSIDKUSA-L
  • molecular weight:
    • 185.136
  • Synonym(s):
    • (4S)-4-hydroxy-2,3,4,5-tetrahydro-(2S)-dipicolinate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(C(O)CC(=NC1C([O-])=O)C([O-])=O)" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_2777&oldid=34543"