Difference between revisions of "CPD-7860"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7002 CPD-7002] == * smiles: ** CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7092 PWY-7092] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58024 TAX-5...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7002 CPD-7002] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7092 PWY-7092] ==
* smiles:
+
* taxonomic range:
** CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58024 TAX-58024]
* inchi key:
+
** InChIKey=YJGANOFPASCZBK-WCNZLWBOSA-K
+
 
* common name:
 
* common name:
** dihydrogeranylgeranyl diphosphate
+
** neolinustatin bioactivation
* molecular weight:
+
** 449.44   
+
 
* Synonym(s):
 
* Synonym(s):
** dihydroGGPP
 
** dihydrogeranylgeranyl-PP
 
** dihydrogeranylgeranyl pyrophosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[RXN-13603]]
* [[RXN-7659]]
+
** 14 associated gene(s):
* [[RXN-7658]]
+
*** [[Tiso_gene_15067]]
 +
*** [[Tiso_gene_6188]]
 +
*** [[Tiso_gene_3467]]
 +
*** [[Tiso_gene_6007]]
 +
*** [[Tiso_gene_13306]]
 +
*** [[Tiso_gene_13305]]
 +
*** [[Tiso_gene_5836]]
 +
*** [[Tiso_gene_8669]]
 +
*** [[Tiso_gene_2843]]
 +
*** [[Tiso_gene_10001]]
 +
*** [[Tiso_gene_6497]]
 +
*** [[Tiso_gene_2344]]
 +
*** [[Tiso_gene_15066]]
 +
*** [[Tiso_gene_6187]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-9674]]
 +
** 14 associated gene(s):
 +
*** [[Tiso_gene_15066]]
 +
*** [[Tiso_gene_13306]]
 +
*** [[Tiso_gene_3467]]
 +
*** [[Tiso_gene_2344]]
 +
*** [[Tiso_gene_6497]]
 +
*** [[Tiso_gene_8669]]
 +
*** [[Tiso_gene_2843]]
 +
*** [[Tiso_gene_6007]]
 +
*** [[Tiso_gene_10001]]
 +
*** [[Tiso_gene_6188]]
 +
*** [[Tiso_gene_13305]]
 +
*** [[Tiso_gene_6187]]
 +
*** [[Tiso_gene_15067]]
 +
*** [[Tiso_gene_5836]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11733 RXN-11733]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-58024}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658526 90658526]
+
{{#set: common name=neolinustatin bioactivation}}
{{#set: smiles=CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C}}
+
{{#set: reaction found=2}}
{{#set: inchi key=InChIKey=YJGANOFPASCZBK-WCNZLWBOSA-K}}
+
{{#set: total reaction=3}}
{{#set: common name=dihydrogeranylgeranyl diphosphate}}
+
{{#set: completion rate=67.0}}
{{#set: molecular weight=449.44    }}
+
{{#set: common name=dihydroGGPP|dihydrogeranylgeranyl-PP|dihydrogeranylgeranyl pyrophosphate}}
+
{{#set: reversible reaction associated=RXN-7659|RXN-7658}}
+

Revision as of 15:30, 21 March 2018

Pathway PWY-7092

  • taxonomic range:
  • common name:
    • neolinustatin bioactivation
  • Synonym(s):

Reaction(s) found

2 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links