Difference between revisions of "GDR nadp m"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACYL-COA ACYL-COA] == * common name: ** an acyl-CoA * Synonym(s): ** fatty acyl thioester-CoA *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7860 CPD-7860] == * smiles: ** CC(=CC=CC=C(C=CC=C(C=CC1(C(CC(C(C=1C)=O)O)(C)C))C)C)C=CC=C(C...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7860 CPD-7860] == |
+ | * smiles: | ||
+ | ** CC(=CC=CC=C(C=CC=C(C=CC1(C(CC(C(C=1C)=O)O)(C)C))C)C)C=CC=C(C)C=CC2(=C(CCCC2(C)C)C) | ||
* common name: | * common name: | ||
− | ** | + | ** 3-hydroxyechinenone |
+ | * inchi key: | ||
+ | ** InChIKey=DFNMSBYEEKBETA-GVVOHZSFSA-N | ||
+ | * molecular weight: | ||
+ | ** 566.865 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3-hydroxy-4-keto-β,β-carotene |
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[R07562]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10120578 10120578] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.8296099.html 8296099] |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C15966 C15966] | ||
+ | {{#set: smiles=CC(=CC=CC=C(C=CC=C(C=CC1(C(CC(C(C=1C)=O)O)(C)C))C)C)C=CC=C(C)C=CC2(=C(CCCC2(C)C)C)}} | ||
+ | {{#set: common name=3-hydroxyechinenone}} | ||
+ | {{#set: inchi key=InChIKey=DFNMSBYEEKBETA-GVVOHZSFSA-N}} | ||
+ | {{#set: molecular weight=566.865 }} | ||
+ | {{#set: common name=3-hydroxy-4-keto-β,β-carotene}} | ||
+ | {{#set: produced by=R07562}} |
Revision as of 15:31, 21 March 2018
Contents
Metabolite CPD-7860
- smiles:
- CC(=CC=CC=C(C=CC=C(C=CC1(C(CC(C(C=1C)=O)O)(C)C))C)C)C=CC=C(C)C=CC2(=C(CCCC2(C)C)C)
- common name:
- 3-hydroxyechinenone
- inchi key:
- InChIKey=DFNMSBYEEKBETA-GVVOHZSFSA-N
- molecular weight:
- 566.865
- Synonym(s):
- 3-hydroxy-4-keto-β,β-carotene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links