Difference between revisions of "5734-TETRAHYDROXYFLAVONE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_105 == * left end position: ** 12646 * transcription direction: ** POSITIVE * right end position: ** 15375 * centisome position: ** 29.1261...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17814 CPD-17814] == * smiles: ** CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17814 CPD-17814] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O |
| − | * | + | * common name: |
| − | ** | + | ** (11Z)-(S)-3-hydroxyhexadec-11-enoyl-CoA |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=SHGDVNGLFXVIAK-BFVORPHASA-J |
| − | * | + | * molecular weight: |
| − | ** | + | ** 1015.898 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[RXN- | + | * [[RXN-16559]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820456 91820456] |
| − | {{#set: | + | {{#set: smiles=CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O}} |
| − | {{#set: | + | {{#set: common name=(11Z)-(S)-3-hydroxyhexadec-11-enoyl-CoA}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=SHGDVNGLFXVIAK-BFVORPHASA-J}} |
| − | {{#set: | + | {{#set: molecular weight=1015.898 }} |
| + | {{#set: consumed by=RXN-16559}} | ||
Revision as of 15:31, 21 March 2018
Contents
Metabolite CPD-17814
- smiles:
- CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
- common name:
- (11Z)-(S)-3-hydroxyhexadec-11-enoyl-CoA
- inchi key:
- InChIKey=SHGDVNGLFXVIAK-BFVORPHASA-J
- molecular weight:
- 1015.898
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O" cannot be used as a page name in this wiki.
