Difference between revisions of "Tiso gene 14998"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11523 CPD-11523] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)CO...")
(Created page with "Category:Gene == Gene Tiso_gene_15885 == * Synonym(s): == Reactions associated == * Reaction: RXN-15556 ** Source: annotation-in-silico_annotation *** Assignment:...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11523 CPD-11523] ==
+
== Gene Tiso_gene_15885 ==
* smiles:
+
** CCC=CCC4(C(=O)CCC(CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
+
* inchi key:
+
** InChIKey=OMDQVIUYDJAWHX-ZMWLRFEFSA-J
+
* common name:
+
** OPC6-3-hydroxyacyl-CoA
+
* molecular weight:
+
** 1027.866   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-10702]]
+
* Reaction: [[RXN-15556]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
* [[RXN-10704]]
+
*** Assignment: automated-name-match
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-7511]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=RXN-15556}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237226 44237226]
+
{{#set: pathway associated=PWY-7511}}
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
+
{{#set: inchi key=InChIKey=OMDQVIUYDJAWHX-ZMWLRFEFSA-J}}
+
{{#set: common name=OPC6-3-hydroxyacyl-CoA}}
+
{{#set: molecular weight=1027.866    }}
+
{{#set: consumed by=RXN-10702}}
+
{{#set: produced by=RXN-10704}}
+

Revision as of 15:32, 21 March 2018

Gene Tiso_gene_15885

  • Synonym(s):

Reactions associated

Pathways associated

External links