Difference between revisions of "ALCOHOL-O-ACETYLTRANSFERASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP CDP] == * smiles: ** C(C2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))OP(OP([O-])([O-])=O)([O-])=O *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACETYLORNTRANSAM-RXN ACETYLORNTRANSAM-RXN] == * direction: ** REVERSIBLE * common name: ** acetylor...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACETYLORNTRANSAM-RXN ACETYLORNTRANSAM-RXN] == |
− | + | * direction: | |
− | + | ** REVERSIBLE | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** acetylornithine_aminotransferase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.6.1.11 EC-2.6.1.11] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[N-ALPHA-ACETYLORNITHINE]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''<=>''' 1 [[CPD-469]][c] '''+''' 1 [[GLT]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 N-acetyl-L-ornithine[c] '''+''' 1 2-oxoglutarate[c] '''<=>''' 1 N-acetyl-L-glutamate 5-semialdehyde[c] '''+''' 1 L-glutamate[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | == | + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[ | + | * Gene: [[Tiso_gene_11231]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: AUTOMATED-NAME-MATCH |
− | * [[ | + | ** Source: [[orthology-synechocystis]] |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | * [[ | + | ** Source: [[orthology-creinhardtii]] |
− | * [[ | + | == Pathways == |
− | * [[ | + | * [[PWY-5154]], L-arginine biosynthesis III (via N-acetyl-L-citrulline): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5154 PWY-5154] |
− | * [[ | + | ** '''7''' reactions found over '''9''' reactions in the full pathway |
− | + | * [[GLUTORN-PWY]], L-ornithine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=GLUTORN-PWY GLUTORN-PWY] | |
+ | ** '''5''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[ARGSYNBSUB-PWY]], L-arginine biosynthesis II (acetyl cycle): [http://metacyc.org/META/NEW-IMAGE?object=ARGSYNBSUB-PWY ARGSYNBSUB-PWY] | ||
+ | ** '''9''' reactions found over '''9''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18049 18049] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02283 R02283] |
− | + | * UNIPROT: | |
− | * LIGAND- | + | ** [http://www.uniprot.org/uniprot/P18335 P18335] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/Q9PIR7 Q9PIR7] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9JTX9 Q9JTX9] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9CHD3 Q9CHD3] |
− | * | + | ** [http://www.uniprot.org/uniprot/P30900 P30900] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P18544 P18544] |
− | * | + | ** [http://www.uniprot.org/uniprot/O74548 O74548] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O14433 O14433] |
− | {{#set: | + | {{#set: direction=REVERSIBLE}} |
− | {{#set: | + | {{#set: common name=acetylornithine_aminotransferase}} |
− | {{#set: | + | {{#set: ec number=EC-2.6.1.11}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_11231}} |
− | {{#set: | + | {{#set: in pathway=PWY-5154|GLUTORN-PWY|ARGSYNBSUB-PWY}} |
− | {{#set: | + | {{#set: reconstruction category=orthology|annotation}} |
+ | {{#set: reconstruction source=annotation-in-silico_annotation|orthology-creinhardtii|orthology-synechocystis|orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Revision as of 16:33, 21 March 2018
Contents
Reaction ACETYLORNTRANSAM-RXN
- direction:
- REVERSIBLE
- common name:
- acetylornithine_aminotransferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 N-ALPHA-ACETYLORNITHINE[c] + 1 2-KETOGLUTARATE[c] <=> 1 CPD-469[c] + 1 GLT[c]
- With common name(s):
- 1 N-acetyl-L-ornithine[c] + 1 2-oxoglutarate[c] <=> 1 N-acetyl-L-glutamate 5-semialdehyde[c] + 1 L-glutamate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_11231
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation
Pathways
- PWY-5154, L-arginine biosynthesis III (via N-acetyl-L-citrulline): PWY-5154
- 7 reactions found over 9 reactions in the full pathway
- GLUTORN-PWY, L-ornithine biosynthesis I: GLUTORN-PWY
- 5 reactions found over 5 reactions in the full pathway
- ARGSYNBSUB-PWY, L-arginine biosynthesis II (acetyl cycle): ARGSYNBSUB-PWY
- 9 reactions found over 9 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-synechocystis
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-creinhardtii
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links