Difference between revisions of "GLUTDEHYD-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-PARATHION AMINO-PARATHION] == * smiles: ** CCOP(OC1(C=CC(=CC=1)N))(OCC)=S * inchi key: **...") |
(Created page with "Category:Gene == Gene Tiso_gene_11561 == * right end position: ** 7394 * transcription direction: ** POSITIVE * left end position: ** 5940 * centisome position: ** 77.0128...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_11561 == |
− | * | + | * right end position: |
− | ** | + | ** 7394 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 5940 |
− | * | + | * centisome position: |
− | ** | + | ** 77.01284 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[NADPH-DEHYDROGENASE-FLAVIN-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: ec-number |
+ | * Reaction: [[RXN-12445]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=7394}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=5940}} | |
− | + | {{#set: centisome position=77.01284 }} | |
− | + | {{#set: reaction associated=NADPH-DEHYDROGENASE-FLAVIN-RXN|RXN-12445}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:33, 21 March 2018
Gene Tiso_gene_11561
- right end position:
- 7394
- transcription direction:
- POSITIVE
- left end position:
- 5940
- centisome position:
- 77.01284
- Synonym(s):
Reactions associated
- Reaction: NADPH-DEHYDROGENASE-FLAVIN-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-12445
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation