|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PEPDEPHOS-RXN PEPDEPHOS-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MPBQ MPBQ] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C=C(C)C(O)=1))C)C |
| * common name: | | * common name: |
− | ** pyruvate_kinase | + | ** 2-methyl-6-phytyl-1,4-benzoquinol |
− | * ec number: | + | * inchi key: |
− | ** [http://enzyme.expasy.org/EC/2.7.1.40 EC-2.7.1.40] | + | ** InChIKey=GTWCNYRFOZKWTL-UOFXASEASA-N |
| + | * molecular weight: |
| + | ** 402.659 |
| * Synonym(s): | | * Synonym(s): |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[RXN-2542]] |
− | ** 1 [[PYRUVATE]][c] '''+''' 1 [[ATP]][c] '''<=>''' 1 [[ADP]][c] '''+''' 1 [[PHOSPHO-ENOL-PYRUVATE]][c] '''+''' 1 [[PROTON]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | * [[RXN-2541]] |
− | ** 1 pyruvate[c] '''+''' 1 ATP[c] '''<=>''' 1 ADP[c] '''+''' 1 phosphoenolpyruvate[c] '''+''' 1 H+[c]
| + | == Reaction(s) of unknown directionality == |
− | | + | |
− | == Genes associated with this reaction ==
| + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_14504]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_18206]]
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_974]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[athaliana]]
| + | |
− | ** [[pantograph]]-[[athaliana]]
| + | |
− | ** [[pantograph]]-[[synechocystis]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | ** [[pantograph]]-[[creinhardtii]]
| + | |
− | ** [[pantograph]]-[[creinhardtii]]
| + | |
− | ** [[pantograph]]-[[creinhardtii]]
| + | |
− | * [[Tiso_gene_14505]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | == Pathways ==
| + | |
− | * [[PWY-1042]], glycolysis IV (plant cytosol): [http://metacyc.org/META/NEW-IMAGE?object=PWY-1042 PWY-1042]
| + | |
− | ** '''9''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[P341-PWY]], glycolysis V (Pyrococcus): [http://metacyc.org/META/NEW-IMAGE?object=P341-PWY P341-PWY]
| + | |
− | ** '''6''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY-2221]], Entner-Doudoroff pathway III (semi-phosphorylative): [http://metacyc.org/META/NEW-IMAGE?object=PWY-2221 PWY-2221]
| + | |
− | ** '''5''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[GLYCOLYSIS]], glycolysis I (from glucose 6-phosphate): [http://metacyc.org/META/NEW-IMAGE?object=GLYCOLYSIS GLYCOLYSIS] | + | |
− | ** '''12''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[NPGLUCAT-PWY]], Entner-Doudoroff pathway II (non-phosphorylative): [http://metacyc.org/META/NEW-IMAGE?object=NPGLUCAT-PWY NPGLUCAT-PWY]
| + | |
− | ** '''4''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[ANAGLYCOLYSIS-PWY]], glycolysis III (from glucose): [http://metacyc.org/META/NEW-IMAGE?object=ANAGLYCOLYSIS-PWY ANAGLYCOLYSIS-PWY]
| + | |
− | ** '''10''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[PWY-7218]], photosynthetic 3-hydroxybutanoate biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7218 PWY-7218]
| + | |
− | ** '''7''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[PWY-6901]], superpathway of glucose and xylose degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6901 PWY-6901]
| + | |
− | ** '''8''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[PWY-7383]], anaerobic energy metabolism (invertebrates, cytosol): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7383 PWY-7383]
| + | |
− | ** '''5''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[P124-PWY]], Bifidobacterium shunt: [http://metacyc.org/META/NEW-IMAGE?object=P124-PWY P124-PWY]
| + | |
− | ** '''11''' reactions found over '''15''' reactions in the full pathway
| + | |
− | * [[PWY-6886]], 1-butanol autotrophic biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6886 PWY-6886]
| + | |
− | ** '''8''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[PWY-5723]], Rubisco shunt: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5723 PWY-5723] | + | |
− | ** '''10''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[FERMENTATION-PWY]], mixed acid fermentation: [http://metacyc.org/META/NEW-IMAGE?object=FERMENTATION-PWY FERMENTATION-PWY]
| + | |
− | ** '''9''' reactions found over '''16''' reactions in the full pathway
| + | |
− | * [[PWY-6142]], gluconeogenesis II (Methanobacterium thermoautotrophicum): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6142 PWY-6142]
| + | |
− | ** '''8''' reactions found over '''14''' reactions in the full pathway
| + | |
− | * [[P122-PWY]], heterolactic fermentation: [http://metacyc.org/META/NEW-IMAGE?object=P122-PWY P122-PWY]
| + | |
− | ** '''14''' reactions found over '''18''' reactions in the full pathway
| + | |
− | * [[PWY-5484]], glycolysis II (from fructose 6-phosphate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5484 PWY-5484]
| + | |
− | ** '''11''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[PWY-7003]], glycerol degradation to butanol: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7003 PWY-7003]
| + | |
− | ** '''8''' reactions found over '''10''' reactions in the full pathway
| + | |
− | == Reconstruction information ==
| + | |
− | * Category: [[orthology]]
| + | |
− | ** Source: [[orthology-athaliana]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | ** Source: [[orthology-creinhardtii]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | ** Source: [[orthology-synechocystis]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | * Category: [[manual]]
| + | |
− | ** Source: [[manual-primary_network]]
| + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * RHEA:
| + | * LIGAND-CPD: |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18157 18157]
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C15882 C15882] |
− | * LIGAND-RXN: | + | * HMDB : HMDB38959 |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00200 R00200] | + | * CHEBI: |
− | * UNIPROT: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75920 75920] |
− | ** [http://www.uniprot.org/uniprot/Q7M034 Q7M034] | + | * METABOLIGHTS : MTBLC75920 |
− | ** [http://www.uniprot.org/uniprot/P11979 P11979] | + | * PUBCHEM: |
− | ** [http://www.uniprot.org/uniprot/P11980 P11980]
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71768135 71768135] |
− | ** [http://www.uniprot.org/uniprot/Q07637 Q07637]
| + | {{#set: smiles=CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C=C(C)C(O)=1))C)C}} |
− | ** [http://www.uniprot.org/uniprot/P34038 P34038] | + | {{#set: common name=2-methyl-6-phytyl-1,4-benzoquinol}} |
− | ** [http://www.uniprot.org/uniprot/P43924 P43924] | + | {{#set: inchi key=InChIKey=GTWCNYRFOZKWTL-UOFXASEASA-N}} |
− | ** [http://www.uniprot.org/uniprot/Q57572 Q57572] | + | {{#set: molecular weight=402.659 }} |
− | ** [http://www.uniprot.org/uniprot/P0AD61 P0AD61]
| + | {{#set: consumed by=RXN-2542}} |
− | ** [http://www.uniprot.org/uniprot/P19680 P19680]
| + | {{#set: produced by=RXN-2541}} |
− | ** [http://www.uniprot.org/uniprot/Q9PIB0 Q9PIB0]
| + | |
− | ** [http://www.uniprot.org/uniprot/P80885 P80885]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9UYU6 Q9UYU6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JWX8 Q9JWX8]
| + | |
− | ** [http://www.uniprot.org/uniprot/P47458 P47458]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q46078 Q46078]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30614 P30614]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22200 P22200]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q27788 Q27788]
| + | |
− | ** [http://www.uniprot.org/uniprot/P51182 P51182]
| + | |
− | ** [http://www.uniprot.org/uniprot/P51181 P51181]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31865 P31865]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00549 P00549]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00548 P00548]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30613 P30613]
| + | |
− | ** [http://www.uniprot.org/uniprot/O75758 O75758]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12928 P12928]
| + | |
− | ** [http://www.uniprot.org/uniprot/O30853 O30853]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30615 P30615]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30616 P30616]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q02499 Q02499]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22360 P22360]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21599 P21599]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14618 P14618]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42954 Q42954]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q40545 Q40545]
| + | |
− | ** [http://www.uniprot.org/uniprot/P52480 P52480]
| + | |
− | ** [http://www.uniprot.org/uniprot/P52489 P52489]
| + | |
− | ** [http://www.uniprot.org/uniprot/P78031 P78031]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q55863 Q55863]
| + | |
− | ** [http://www.uniprot.org/uniprot/P73534 P73534]
| + | |
− | ** [http://www.uniprot.org/uniprot/O65595 O65595]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42806 Q42806]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43117 Q43117]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q10208 Q10208]
| + | |
− | {{#set: direction=REVERSIBLE}} | + | |
− | {{#set: common name=pyruvate_kinase}} | + | |
− | {{#set: ec number=EC-2.7.1.40}}
| + | |
− | {{#set: gene associated=Tiso_gene_14504|Tiso_gene_18206|Tiso_gene_974|Tiso_gene_14505}} | + | |
− | {{#set: in pathway=PWY-1042|P341-PWY|PWY-2221|GLYCOLYSIS|NPGLUCAT-PWY|ANAGLYCOLYSIS-PWY|PWY-7218|PWY-6901|PWY-7383|P124-PWY|PWY-6886|PWY-5723|FERMENTATION-PWY|PWY-6142|P122-PWY|PWY-5484|PWY-7003}}
| + | |
− | {{#set: reconstruction category=orthology|manual|annotation}} | + | |
− | {{#set: reconstruction source=annotation-experimental_annotation|orthology-esiliculosus|annotation-in-silico_annotation|orthology-athaliana|orthology-synechocystis|manual-primary_network|orthology-creinhardtii}} | + | |
− | {{#set: reconstruction tool=pantograph|pathwaytools}} | + | |