Difference between revisions of "DCMP-DEAMINASE-RXN"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIAMINOPIMDECARB-RXN DIAMINOPIMDECARB-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** diami...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13533 CPD-13533] == * smiles: ** CCC(CC(SCCNC(CCNC(C(C(COP(=O)([O-])OP(OCC1(OC(C(C1OP([O-])...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13533 CPD-13533] == |
− | * | + | * smiles: |
− | ** | + | ** CCC(CC(SCCNC(CCNC(C(C(COP(=O)([O-])OP(OCC1(OC(C(C1OP([O-])([O-])=O)O)N3(C=NC2(C(=NC=NC=23)N))))([O-])=O)(C)C)O)=O)=O)=O)O |
* common name: | * common name: | ||
− | ** | + | ** (R)-3-hydroxyvaleryl-CoA |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=YYGYPCRWZMLSGK-ORUMCERNSA-J |
+ | * molecular weight: | ||
+ | ** 863.619 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** D-β-hydroxyvaleryl-CoA | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-12560]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | = | + | |
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54758578 54758578] |
− | + | {{#set: smiles=CCC(CC(SCCNC(CCNC(C(C(COP(=O)([O-])OP(OCC1(OC(C(C1OP([O-])([O-])=O)O)N3(C=NC2(C(=NC=NC=23)N))))([O-])=O)(C)C)O)=O)=O)=O)O}} | |
− | + | {{#set: common name=(R)-3-hydroxyvaleryl-CoA}} | |
− | + | {{#set: inchi key=InChIKey=YYGYPCRWZMLSGK-ORUMCERNSA-J}} | |
− | + | {{#set: molecular weight=863.619 }} | |
− | + | {{#set: common name=D-β-hydroxyvaleryl-CoA}} | |
− | + | {{#set: reversible reaction associated=RXN-12560}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:36, 21 March 2018
Contents
Metabolite CPD-13533
- smiles:
- CCC(CC(SCCNC(CCNC(C(C(COP(=O)([O-])OP(OCC1(OC(C(C1OP([O-])([O-])=O)O)N3(C=NC2(C(=NC=NC=23)N))))([O-])=O)(C)C)O)=O)=O)=O)O
- common name:
- (R)-3-hydroxyvaleryl-CoA
- inchi key:
- InChIKey=YYGYPCRWZMLSGK-ORUMCERNSA-J
- molecular weight:
- 863.619
- Synonym(s):
- D-β-hydroxyvaleryl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCC(CC(SCCNC(CCNC(C(C(COP(=O)([O-])OP(OCC1(OC(C(C1OP([O-])([O-])=O)O)N3(C=NC2(C(=NC=NC=23)N))))([O-])=O)(C)C)O)=O)=O)=O)O" cannot be used as a page name in this wiki.