Difference between revisions of "ACCOAtm"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Holo-EntF Holo-EntF] == * common name: ** a holo-[EntF peptidyl-carrier protein] * Synonym(s):...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15633 CPD-15633] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-] * common name: ** aldehy...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Holo-EntF Holo-EntF] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15633 CPD-15633] ==
 +
* smiles:
 +
** [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-]
 
* common name:
 
* common name:
** a holo-[EntF peptidyl-carrier protein]
+
** aldehydo-D-galacturonate
 +
* inchi key:
 +
** InChIKey=IAJILQKETJEXLJ-RSJOWCBRSA-M
 +
* molecular weight:
 +
** 193.133   
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15889]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[GALACTUROISOM-RXN]]
 
== External links  ==
 
== External links  ==
{{#set: common name=a holo-[EntF peptidyl-carrier protein]}}
+
* PUBCHEM:
{{#set: produced by=RXN-15889}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1593918 1593918]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=12952 12952]
 +
{{#set: smiles=[CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-]}}
 +
{{#set: common name=aldehydo-D-galacturonate}}
 +
{{#set: inchi key=InChIKey=IAJILQKETJEXLJ-RSJOWCBRSA-M}}
 +
{{#set: molecular weight=193.133    }}
 +
{{#set: reversible reaction associated=GALACTUROISOM-RXN}}

Revision as of 15:39, 21 March 2018

Metabolite CPD-15633

  • smiles:
    • [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-]
  • common name:
    • aldehydo-D-galacturonate
  • inchi key:
    • InChIKey=IAJILQKETJEXLJ-RSJOWCBRSA-M
  • molecular weight:
    • 193.133
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-" cannot be used as a page name in this wiki.