Difference between revisions of "NAPHTHOATE-SYN-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15131 RXN-15131] == * direction: ** LEFT-TO-RIGHT * common name: ** cystathionine beta-lyase *...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3187 CPD-3187] == * smiles: ** C1(CCC(O)([N+](C)1)C2(=CN=CC=C2)) * common name: ** 2'-hydro...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15131 RXN-15131] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3187 CPD-3187] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(CCC(O)([N+](C)1)C2(=CN=CC=C2))
 
* common name:
 
* common name:
−
** cystathionine beta-lyase
+
** 2'-hydroxynicotine
 +
* inchi key:
 +
** InChIKey=BOQRPPFUUSHFGW-SNVBAGLBSA-O
 +
* molecular weight:
 +
** 179.241   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[L-CYSTATHIONINE]][c] '''=>''' 1 [[HOMO-CYS]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[2-AMINOACRYLATE]][c]
+
* [[RXN66-146]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 L-cystathionine[c] '''=>''' 1 L-homocysteine[c] '''+''' 1 H+[c] '''+''' 1 2-aminoprop-2-enoate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_3732]]
+
−
** EXPERIMENTAL_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[HOMOSER-METSYN-PWY]], L-methionine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=HOMOSER-METSYN-PWY HOMOSER-METSYN-PWY]
+
−
** '''4''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-801]], L-homocysteine and L-cysteine interconversion: [http://metacyc.org/META/NEW-IMAGE?object=PWY-801 PWY-801]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-702]], L-methionine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-702 PWY-702]
+
−
** '''5''' reactions found over '''6''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=cystathionine beta-lyase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245599 25245599]
−
{{#set: gene associated=Tiso_gene_3732}}
+
* HMDB : HMDB01329
−
{{#set: in pathway=HOMOSER-METSYN-PWY|PWY-801|PWY-702}}
+
{{#set: smiles=C1(CCC(O)([N+](C)1)C2(=CN=CC=C2))}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: common name=2'-hydroxynicotine}}
−
{{#set: reconstruction source=annotation-experimental_annotation}}
+
{{#set: inchi key=InChIKey=BOQRPPFUUSHFGW-SNVBAGLBSA-O}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: molecular weight=179.241    }}
 +
{{#set: produced by=RXN66-146}}

Revision as of 15:41, 21 March 2018

Metabolite CPD-3187

  • smiles:
    • C1(CCC(O)([N+](C)1)C2(=CN=CC=C2))
  • common name:
    • 2'-hydroxynicotine
  • inchi key:
    • InChIKey=BOQRPPFUUSHFGW-SNVBAGLBSA-O
  • molecular weight:
    • 179.241
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(CCC(O)([N+](C)1)C2(=CN=CC=C2))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=NAPHTHOATE-SYN-RXN&oldid=35650"