Difference between revisions of "Trans-D2-cis-cis-D15-27-C46-3-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_17967 == * left end position: ** 159 * transcription direction: ** POSITIVE * right end position: ** 2220 * centisome position: ** 4.753363...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG-PROTOPORPHYRIN-MONOMETHYL-ESTER MG-PROTOPORPHYRIN-MONOMETHYL-ESTER] == * smiles: ** C=CC2(C(...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_17967 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG-PROTOPORPHYRIN-MONOMETHYL-ESTER MG-PROTOPORPHYRIN-MONOMETHYL-ESTER] ==
−
* left end position:
+
* smiles:
−
** 159
+
** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)OC)C(N56)=C7))))8))))
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** magnesium-protoporphyrin IX 13-monomethyl ester
−
* right end position:
+
* molecular weight:
−
** 2220
+
** 597.975    
−
* centisome position:
+
−
** 4.753363    
+
 
* Synonym(s):
 
* Synonym(s):
 +
** Mg-protoporphyrin monomethyl ester
 +
** magnesium protoporphyrin monomethyl ester
 +
** MgPMME
 +
** magnesium-protoporphyrin IX 13-methyl ester
 +
** MgP monomethyl ester
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[ACOA120or]]
+
* [[RXN-5282]]
−
** [[pantograph]]-[[creinhardtii]]
+
== Reaction(s) known to produce the compound ==
−
* [[ACOA140or]]
+
* [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]]
−
** [[pantograph]]-[[creinhardtii]]
+
== Reaction(s) of unknown directionality ==
−
* [[ACOA160or]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[ACOA40or]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[ACOA80or]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[LONG-CHAIN-ACYL-COA-DEHYDROGENASE-RXN]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[PPCOAOm]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[RXN-11734]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[RXN-13451]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[RXN-13615]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[RXN-14131]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[RXN-14229]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[RXN-14262]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[RXN-14278]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[RXN-16540]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[RXN-16557]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
== Pathways associated ==
+
−
* [[PWY-7094]]
+
−
* [[PWY-7654]]
+
−
* [[PWY-7656]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=159}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657954 90657954]
−
{{#set: right end position=2220}}
+
* CHEBI:
−
{{#set: centisome position=4.753363   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60491 60491]
−
{{#set: reaction associated=ACOA120or|ACOA140or|ACOA160or|ACOA40or|ACOA80or|LONG-CHAIN-ACYL-COA-DEHYDROGENASE-RXN|PPCOAOm|RXN-11734|RXN-13451|RXN-13615|RXN-14131|RXN-14229|RXN-14262|RXN-14278|RXN-16540|RXN-16557}}
+
* LIGAND-CPD:
−
{{#set: pathway associated=PWY-7094|PWY-7654|PWY-7656}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C04536 C04536]
 +
{{#set: smiles=C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)OC)C(N56)=C7))))8))))}}
 +
{{#set: common name=magnesium-protoporphyrin IX 13-monomethyl ester}}
 +
{{#set: molecular weight=597.975   }}
 +
{{#set: common name=Mg-protoporphyrin monomethyl ester|magnesium protoporphyrin monomethyl ester|MgPMME|magnesium-protoporphyrin IX 13-methyl ester|MgP monomethyl ester}}
 +
{{#set: consumed by=RXN-5282}}
 +
{{#set: produced by=RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN}}

Revision as of 16:42, 21 March 2018

Metabolite MG-PROTOPORPHYRIN-MONOMETHYL-ESTER

  • smiles:
    • C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)OC)C(N56)=C7))))8))))
  • common name:
    • magnesium-protoporphyrin IX 13-monomethyl ester
  • molecular weight:
    • 597.975
  • Synonym(s):
    • Mg-protoporphyrin monomethyl ester
    • magnesium protoporphyrin monomethyl ester
    • MgPMME
    • magnesium-protoporphyrin IX 13-methyl ester
    • MgP monomethyl ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)OC)C(N56)=C7))))8))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Trans-D2-cis-cis-D15-27-C46-3-ACPs&oldid=35752"