Difference between revisions of "Tiso gene 5505"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12014 CPD-12014] == * smiles: ** CC(=O)NCCC1(=CNC2(C1=CC(OC)=C(O)C=2)) * inchi key: ** InCh...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DUTP-PYROP-RXN DUTP-PYROP-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** inosine_triphosph...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DUTP-PYROP-RXN DUTP-PYROP-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** inosine_triphosphate |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.6.1.23 EC-3.6.1.23] |
+ | ** [http://enzyme.expasy.org/EC/3.6.1.9 EC-3.6.1.9] | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[DUTP]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[DUMP]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 dUTP[c] '''+''' 1 H2O[c] '''=>''' 1 diphosphate[c] '''+''' 1 H+[c] '''+''' 1 dUMP[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_18793]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | * Gene: [[Tiso_gene_18792]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-7206]], pyrimidine deoxyribonucleotides dephosphorylation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7206 PWY-7206] | ||
+ | ** '''2''' reactions found over '''3''' reactions in the full pathway | ||
+ | * [[PWY-7184]], pyrimidine deoxyribonucleotides de novo biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7184 PWY-7184] | ||
+ | ** '''9''' reactions found over '''9''' reactions in the full pathway | ||
+ | * [[PWY-7187]], pyrimidine deoxyribonucleotides de novo biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7187 PWY-7187] | ||
+ | ** '''4''' reactions found over '''7''' reactions in the full pathway | ||
+ | * [[PWY-6545]], pyrimidine deoxyribonucleotides de novo biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6545 PWY-6545] | ||
+ | ** '''8''' reactions found over '''9''' reactions in the full pathway | ||
+ | * [[PWY0-166]], superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis (E. coli): [http://metacyc.org/META/NEW-IMAGE?object=PWY0-166 PWY0-166] | ||
+ | ** '''12''' reactions found over '''17''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[manual]] | ||
+ | ** Source: [[manual-primary_network]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10248 10248] |
− | + | * LIGAND-RXN: | |
− | * LIGAND- | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02100 R02100] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/Q89932 Q89932] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P33316 P33316] |
− | * | + | ** [http://www.uniprot.org/uniprot/O15923 O15923] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9PMK9 Q9PMK9] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9Z9C2 Q9Z9C2] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9JUW1 Q9JUW1] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P43792 P43792] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P32518 P32518] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P68635 P68635] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P68634 P68634] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q76RE7 Q76RE7] |
+ | ** [http://www.uniprot.org/uniprot/P03195 P03195] | ||
+ | ** [http://www.uniprot.org/uniprot/Q89662 Q89662] | ||
+ | ** [http://www.uniprot.org/uniprot/Q00030 Q00030] | ||
+ | ** [http://www.uniprot.org/uniprot/P33317 P33317] | ||
+ | ** [http://www.uniprot.org/uniprot/Q45920 Q45920] | ||
+ | ** [http://www.uniprot.org/uniprot/P43058 P43058] | ||
+ | ** [http://www.uniprot.org/uniprot/O80091 O80091] | ||
+ | ** [http://www.uniprot.org/uniprot/O36404 O36404] | ||
+ | ** [http://www.uniprot.org/uniprot/O41033 O41033] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9YML1 Q9YML1] | ||
+ | ** [http://www.uniprot.org/uniprot/O39251 O39251] | ||
+ | ** [http://www.uniprot.org/uniprot/O01934 O01934] | ||
+ | ** [http://www.uniprot.org/uniprot/P10234 P10234] | ||
+ | ** [http://www.uniprot.org/uniprot/P06968 P06968] | ||
+ | ** [http://www.uniprot.org/uniprot/P09254 P09254] | ||
+ | ** [http://www.uniprot.org/uniprot/P28892 P28892] | ||
+ | ** [http://www.uniprot.org/uniprot/P28893 P28893] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=inosine_triphosphate}} | ||
+ | {{#set: ec number=EC-3.6.1.23}} | ||
+ | {{#set: ec number=EC-3.6.1.9}} | ||
+ | {{#set: gene associated=Tiso_gene_18793|Tiso_gene_18792}} | ||
+ | {{#set: in pathway=PWY-7206|PWY-7184|PWY-7187|PWY-6545|PWY0-166}} | ||
+ | {{#set: reconstruction category=orthology|manual|annotation}} | ||
+ | {{#set: reconstruction source=manual-primary_network|annotation-in-silico_annotation|orthology-athaliana}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Revision as of 15:45, 21 March 2018
Contents
Reaction DUTP-PYROP-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- inosine_triphosphate
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 dUTP[c] + 1 H2O[c] => 1 diphosphate[c] + 1 H+[c] + 1 dUMP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_18793
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-athaliana
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_18792
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- PWY-7206, pyrimidine deoxyribonucleotides dephosphorylation: PWY-7206
- 2 reactions found over 3 reactions in the full pathway
- PWY-7184, pyrimidine deoxyribonucleotides de novo biosynthesis I: PWY-7184
- 9 reactions found over 9 reactions in the full pathway
- PWY-7187, pyrimidine deoxyribonucleotides de novo biosynthesis II: PWY-7187
- 4 reactions found over 7 reactions in the full pathway
- PWY-6545, pyrimidine deoxyribonucleotides de novo biosynthesis III: PWY-6545
- 8 reactions found over 9 reactions in the full pathway
- PWY0-166, superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis (E. coli): PWY0-166
- 12 reactions found over 17 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-athaliana
- Category: manual
- Source: manual-primary_network
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: