Difference between revisions of "Tiso gene 6592"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3R-5Z-3-hydroxy-tetradec-5-enoyl-ACPs 3R-5Z-3-hydroxy-tetradec-5-enoyl-ACPs] == * common name:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1327 CPD0-1327] == * smiles: ** C1(=C(C(=O)NC(N1)=O)F) * common name: ** 5-fluorouracil *...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1327 CPD0-1327] == |
| + | * smiles: | ||
| + | ** C1(=C(C(=O)NC(N1)=O)F) | ||
* common name: | * common name: | ||
| − | ** | + | ** 5-fluorouracil |
| + | * inchi key: | ||
| + | ** InChIKey=GHASVSINZRGABV-UHFFFAOYSA-N | ||
| + | * molecular weight: | ||
| + | ** 130.078 | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[5FLURAt]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * DRUGBANK : DB00544 |
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3385 3385] |
| − | {{#set: | + | * HMDB : HMDB14684 |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C07649 C07649] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.3268.html 3268] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=46345 46345] | ||
| + | {{#set: smiles=C1(=C(C(=O)NC(N1)=O)F)}} | ||
| + | {{#set: common name=5-fluorouracil}} | ||
| + | {{#set: inchi key=InChIKey=GHASVSINZRGABV-UHFFFAOYSA-N}} | ||
| + | {{#set: molecular weight=130.078 }} | ||
| + | {{#set: reversible reaction associated=5FLURAt}} | ||
Revision as of 15:47, 21 March 2018
Contents
Metabolite CPD0-1327
- smiles:
- C1(=C(C(=O)NC(N1)=O)F)
- common name:
- 5-fluorouracil
- inchi key:
- InChIKey=GHASVSINZRGABV-UHFFFAOYSA-N
- molecular weight:
- 130.078
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
