Difference between revisions of "RXN-9157"

Revision as of 16:51, 21 March 2018

"an [L-cysteine desulfurase]-L-cysteine" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-29 CPDQT-29] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cysteine-Desulfurase-L-cysteine Cysteine-Desulfurase-L-cysteine] ==
-* smiles:
-** CSCCCCCCC(=O)C([O-])=O
-* inchi key:
-** InChIKey=QDZNKMGEHAHOTA-UHFFFAOYSA-M
 * common name:
-** 8-(methylthio)-2-oxooctanoate
+** an [L-cysteine desulfurase]-L-cysteine
-* molecular weight:
-** 203.276
 * Synonym(s):
-** 8-(methylthio)-2-oxooctanoic acid
 == Reaction(s) known to consume the compound ==
+* [[RXN0-308]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-18205]]
+* [[RXN-14382]]
-* [[RXNQT-4171]]
 == Reaction(s) of unknown directionality ==
+* [[RXN-12587]]
 == External links  ==
-* PUBCHEM:
+{{#set: common name=an [L-cysteine desulfurase]-L-cysteine}}
-** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237313 44237313]
+{{#set: consumed by=RXN0-308}}
-* KNAPSACK : C00007643
+{{#set: produced by=RXN-14382}}
-{{#set: smiles=CSCCCCCCC(=O)C([O-])=O}}
+{{#set: reversible reaction associated=RXN-12587}}
-{{#set: inchi key=InChIKey=QDZNKMGEHAHOTA-UHFFFAOYSA-M}}
-{{#set: common name=8-(methylthio)-2-oxooctanoate}}
-{{#set: molecular weight=203.276    }}
-{{#set: common name=8-(methylthio)-2-oxooctanoic acid}}
-{{#set: produced by=RXN-18205|RXNQT-4171}}