Difference between revisions of "Tiso gene 15858"

Revision as of 15:51, 21 March 2018

"CSCCCCCCC(=O)C([O-])=O" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=16S-rRNA-guanine-966 16S-rRNA-guanine-966] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-29 CPDQT-29] ==
+* smiles:
+** CSCCCCCCC(=O)C([O-])=O
 * common name:
-** a guanine966 in 16S rRNA
+** 8-(methylthio)-2-oxooctanoate
+* inchi key:
+** InChIKey=QDZNKMGEHAHOTA-UHFFFAOYSA-M
+* molecular weight:
+** 203.276
 * Synonym(s):
+** 8-(methylthio)-2-oxooctanoic acid
 == Reaction(s) known to consume the compound ==
-* [[RXN0-6515]]
 == Reaction(s) known to produce the compound ==
+* [[RXN-18205]]
+* [[RXNQT-4171]]
 == Reaction(s) of unknown directionality ==
 == External links  ==
-{{#set: common name=a guanine966 in 16S rRNA}}
+* PUBCHEM:
-{{#set: consumed by=RXN0-6515}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237313 44237313]
+* KNAPSACK : C00007643
+{{#set: smiles=CSCCCCCCC(=O)C([O-])=O}}
+{{#set: common name=8-(methylthio)-2-oxooctanoate}}
+{{#set: inchi key=InChIKey=QDZNKMGEHAHOTA-UHFFFAOYSA-M}}
+{{#set: molecular weight=203.276    }}
+{{#set: common name=8-(methylthio)-2-oxooctanoic acid}}
+{{#set: produced by=RXN-18205|RXNQT-4171}}