Difference between revisions of "Tiso gene 10634"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13575 CPD-13575] == * smiles: ** CC1(C(=CCOP([O-])(=O)[O-])SC(C(=O)[O-])N=1) * inchi key: *...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15006 RXN-15006] == * direction: ** LEFT-TO-RIGHT * common name: ** n-acetyl-gamma-glutamyl-pho...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13575 CPD-13575] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15006 RXN-15006] ==
−
* smiles:
+
* direction:
−
** CC1(C(=CCOP([O-])(=O)[O-])SC(C(=O)[O-])N=1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=PQMCQNOVNFNPFJ-HYIMLASBSA-K
+
 
* common name:
 
* common name:
−
** 2-[(2R,5Z)-2-carboxy-4-methylthiazol-5(2H)-ylidene]ethyl phosphate
+
** n-acetyl-gamma-glutamyl-phosphate_reductase
−
* molecular weight:
+
** ORF
−
** 264.169   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.2.1.38 EC-1.2.1.38]
 
* Synonym(s):
 
* Synonym(s):
−
** cThz*-P
 
−
** thiazole tautomer
 
−
** (R,Z)-2-(2-carboxy-4-methylthiazol-5(2H)-ylidene)ethyl phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-12611]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[NADPH]][c] '''+''' 1 [[LysW-L-glutamate-5-phosphate]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[LysW-L-glutamate-5-semialdehyde]][c] '''+''' 1 [[NADP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 NADPH[c] '''+''' 1 an [L-2-aminoadipate carrier protein]-L-glutamate 5-phosphate[c] '''+''' 1 H+[c] '''=>''' 1 phosphate[c] '''+''' 1 an [L-2-aminoadipate carrier protein]-L-glutamate 5-semialdehyde[c] '''+''' 1 NADP+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_6700]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_8102]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-7400]], L-arginine biosynthesis IV (archaebacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7400 PWY-7400]
 +
** '''7''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53477654 53477654]
+
{{#set: common name=n-acetyl-gamma-glutamyl-phosphate_reductase}}
−
* CHEBI:
+
{{#set: common name=ORF}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62899 62899]
+
{{#set: ec number=EC-1.2.1.38}}
−
{{#set: smiles=CC1(C(=CCOP([O-])(=O)[O-])SC(C(=O)[O-])N=1)}}
+
{{#set: gene associated=Tiso_gene_6700|Tiso_gene_8102}}
−
{{#set: inchi key=InChIKey=PQMCQNOVNFNPFJ-HYIMLASBSA-K}}
+
{{#set: in pathway=PWY-7400}}
−
{{#set: common name=2-[(2R,5Z)-2-carboxy-4-methylthiazol-5(2H)-ylidene]ethyl phosphate}}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: molecular weight=264.169    }}
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}}
−
{{#set: common name=cThz*-P|thiazole tautomer|(R,Z)-2-(2-carboxy-4-methylthiazol-5(2H)-ylidene)ethyl phosphate}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: consumed by=RXN-12611}}
+

Revision as of 15:52, 21 March 2018

Reaction RXN-15006

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • n-acetyl-gamma-glutamyl-phosphate_reductase
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7400, L-arginine biosynthesis IV (archaebacteria): PWY-7400
    • 7 reactions found over 9 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_10634&oldid=36908"