Difference between revisions of "3.6.3.1-RXN"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12508 RXN-12508] == * direction: ** LEFT-TO-RIGHT * common name: ** 2-(α-hydroxyethyl)-TP...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13575 CPD-13575] == * smiles: ** CC1(C(=CCOP([O-])(=O)[O-])SC(C(=O)[O-])N=1) * common name:...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13575 CPD-13575] == |
− | * | + | * smiles: |
− | ** | + | ** CC1(C(=CCOP([O-])(=O)[O-])SC(C(=O)[O-])N=1) |
* common name: | * common name: | ||
− | ** 2-( | + | ** 2-[(2R,5Z)-2-carboxy-4-methylthiazol-5(2H)-ylidene]ethyl phosphate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=PQMCQNOVNFNPFJ-HYIMLASBSA-K |
− | ** | + | * molecular weight: |
+ | ** 264.169 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** cThz*-P | ||
+ | ** thiazole tautomer | ||
+ | ** (R,Z)-2-(2-carboxy-4-methylthiazol-5(2H)-ylidene)ethyl phosphate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-12611]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53477654 53477654] |
− | + | * CHEBI: | |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62899 62899] |
− | + | {{#set: smiles=CC1(C(=CCOP([O-])(=O)[O-])SC(C(=O)[O-])N=1)}} | |
− | {{#set: common name= | + | {{#set: common name=2-[(2R,5Z)-2-carboxy-4-methylthiazol-5(2H)-ylidene]ethyl phosphate}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=PQMCQNOVNFNPFJ-HYIMLASBSA-K}} |
− | + | {{#set: molecular weight=264.169 }} | |
− | {{#set: | + | {{#set: common name=cThz*-P|thiazole tautomer|(R,Z)-2-(2-carboxy-4-methylthiazol-5(2H)-ylidene)ethyl phosphate}} |
− | {{#set: | + | {{#set: consumed by=RXN-12611}} |
− | + | ||
− | {{#set: | + |
Revision as of 15:52, 21 March 2018
Contents
Metabolite CPD-13575
- smiles:
- CC1(C(=CCOP([O-])(=O)[O-])SC(C(=O)[O-])N=1)
- common name:
- 2-[(2R,5Z)-2-carboxy-4-methylthiazol-5(2H)-ylidene]ethyl phosphate
- inchi key:
- InChIKey=PQMCQNOVNFNPFJ-HYIMLASBSA-K
- molecular weight:
- 264.169
- Synonym(s):
- cThz*-P
- thiazole tautomer
- (R,Z)-2-(2-carboxy-4-methylthiazol-5(2H)-ylidene)ethyl phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(C(=CCOP([O-])(=O)[O-])SC(C(=O)[O-])N=1)" cannot be used as a page name in this wiki.
"2-[(2R,5Z)-2-carboxy-4-methylthiazol-5(2H)-ylidene]ethyl phosphate" cannot be used as a page name in this wiki.