Difference between revisions of "RXN-17876"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DETHIOBIOTIN DETHIOBIOTIN] == * smiles: ** CC1(NC(=O)NC1CCCCCC(=O)[O-]) * inchi key: ** InChIKe...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.12.1-RXN 2.7.12.1-RXN] == * direction: ** REVERSIBLE * common name: ** ORF * ec number: ** [htt...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.12.1-RXN 2.7.12.1-RXN] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** ORF |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.7.11.11 EC-2.7.11.11] |
| + | ** [http://enzyme.expasy.org/EC/2.7.12.1 EC-2.7.12.1] | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | * [[ | + | ** 1 [[ATP]][c] '''+''' 1 [[Protein-L-serines]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[Protein-Phosphoserines]][c] '''+''' 1 [[ADP]][c] |
| − | == | + | * With common name(s): |
| − | * [[ | + | ** 1 ATP[c] '''+''' 1 a [protein]-L-serine[c] '''<=>''' 1 H+[c] '''+''' 1 a protein L-serine phosphate[c] '''+''' 1 ADP[c] |
| − | == | + | |
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_1810]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | * LIGAND-RXN: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00162 R00162] | |
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: common name=ORF}} | |
| − | * LIGAND- | + | {{#set: ec number=EC-2.7.11.11}} |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: ec number=EC-2.7.12.1}} |
| − | + | {{#set: gene associated=Tiso_gene_1810}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation}} |
| − | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 15:53, 21 March 2018
Contents
Reaction 2.7.12.1-RXN
- direction:
- REVERSIBLE
- common name:
- ORF
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ATP[c] + 1 Protein-L-serines[c] <=> 1 PROTON[c] + 1 Protein-Phosphoserines[c] + 1 ADP[c]
- With common name(s):
- 1 ATP[c] + 1 a [protein]-L-serine[c] <=> 1 H+[c] + 1 a protein L-serine phosphate[c] + 1 ADP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_1810
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- LIGAND-RXN:
