Difference between revisions of "SULFOCYS-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OROTATE OROTATE] == * smiles: ** C1(=C(C([O-])=O)NC(NC(=O)1)=O) * inchi key: ** InChIKey=PXQPEW...") |
(Created page with "Category:Gene == Gene Tiso_gene_14456 == * right end position: ** 4528 * transcription direction: ** NEGATIVE * left end position: ** 717 * centisome position: ** 12.70150...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_14456 == |
− | * | + | * right end position: |
− | ** | + | ** 4528 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 717 |
− | * | + | * centisome position: |
− | ** | + | ** 12.701506 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[3.4.11.9-RXN]] |
− | + | ** Source: [[annotation-experimental_annotation]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | * | + | * Reaction: [[CREATINASE-RXN]] |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | * [[ | + | == Pathways associated == |
− | == | + | * [[CRNFORCAT-PWY]] |
− | * [[ | + | |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=4528}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=717}} | |
− | + | {{#set: centisome position=12.701506 }} | |
− | + | {{#set: reaction associated=3.4.11.9-RXN|CREATINASE-RXN}} | |
− | + | {{#set: pathway associated=CRNFORCAT-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: | + |
Revision as of 16:54, 21 March 2018
Gene Tiso_gene_14456
- right end position:
- 4528
- transcription direction:
- NEGATIVE
- left end position:
- 717
- centisome position:
- 12.701506
- Synonym(s):
Reactions associated
- Reaction: 3.4.11.9-RXN
- Source: annotation-experimental_annotation
- Assignment: automated-name-match
- Source: annotation-experimental_annotation
- Reaction: CREATINASE-RXN
- Source: orthology-esiliculosus