Difference between revisions of "NN-DIMETHYLANILINE-N-OXIDE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLANTOATE ALLANTOATE] == * smiles: ** C(C(=O)[O-])(NC(=O)N)NC(=O)N * inchi key: ** InChIKey=NU...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.127-RXN 2.1.1.127-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** ribulose-_bisphosph...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.127-RXN 2.1.1.127-RXN] == |
| − | + | * direction: | |
| − | + | ** LEFT-TO-RIGHT | |
| − | * | + | |
| − | ** | + | |
* common name: | * common name: | ||
| − | ** | + | ** ribulose-_bisphosphate_carboxylase_oxygenase_large_subunit_n-_chloropl |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.1.1.127 EC-2.1.1.127] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | = | + | ** 1 [[Rubisco-lysine]][c] '''+''' 3 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 3 [[PROTON]][c] '''+''' 1 [[Rubisco-trimethylated-lysine]][c] '''+''' 3 [[ADENOSYL-HOMO-CYS]][c] |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** 1 a [ribulose-1,5-bisphosphate-carboxylase]-lysine[c] '''+''' 3 S-adenosyl-L-methionine[c] '''=>''' 3 H+[c] '''+''' 1 a [ribulose-1,5-bisphosphate-carboxylase]-N6,N6,N6-trimethyl-L-lysine[c] '''+''' 3 S-adenosyl-L-homocysteine[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_6151]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | * | + | * UNIPROT: |
| − | + | ** [http://www.uniprot.org/uniprot/P94026 P94026] | |
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=ribulose-_bisphosphate_carboxylase_oxygenase_large_subunit_n-_chloropl}} | |
| − | ** [http:// | + | {{#set: ec number=EC-2.1.1.127}} |
| − | + | {{#set: gene associated=Tiso_gene_6151}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 15:55, 21 March 2018
Contents
Reaction 2.1.1.127-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- ribulose-_bisphosphate_carboxylase_oxygenase_large_subunit_n-_chloropl
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Rubisco-lysine[c] + 3 S-ADENOSYLMETHIONINE[c] => 3 PROTON[c] + 1 Rubisco-trimethylated-lysine[c] + 3 ADENOSYL-HOMO-CYS[c]
- With common name(s):
- 1 a [ribulose-1,5-bisphosphate-carboxylase]-lysine[c] + 3 S-adenosyl-L-methionine[c] => 3 H+[c] + 1 a [ribulose-1,5-bisphosphate-carboxylase]-N6,N6,N6-trimethyl-L-lysine[c] + 3 S-adenosyl-L-homocysteine[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_6151
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- UNIPROT:
