Difference between revisions of "Tiso gene 10824"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TDP TDP] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(COP(=O)([O-])OP(=O)([O-])[O-])O2)) * in...") |
(Created page with "Category:Gene == Gene Tiso_gene_4155 == * right end position: ** 15163 * transcription direction: ** POSITIVE * left end position: ** 2708 * centisome position: ** 17.6716...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_4155 == |
− | * | + | * right end position: |
− | ** | + | ** 15163 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 2708 |
− | * | + | * centisome position: |
− | ** | + | ** 17.671627 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[ADENOSINETRIPHOSPHATASE-RXN]] |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | + | * Reaction: [[ATPASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
− | == | + | * Reaction: [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]] |
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-12195]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-12196]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN0-5462]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7184]] | ||
+ | * [[PWY-7198]] | ||
+ | * [[PWY-6545]] | ||
+ | * [[PWY-7210]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=15163}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=2708}} | |
− | + | {{#set: centisome position=17.671627 }} | |
− | + | {{#set: reaction associated=ADENOSINETRIPHOSPHATASE-RXN|ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}} | |
− | + | {{#set: pathway associated=PWY-7184|PWY-7198|PWY-6545|PWY-7210}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Revision as of 15:55, 21 March 2018
Gene Tiso_gene_4155
- right end position:
- 15163
- transcription direction:
- POSITIVE
- left end position:
- 2708
- centisome position:
- 17.671627
- Synonym(s):
Reactions associated
- Reaction: ADENOSINETRIPHOSPHATASE-RXN
- Source: orthology-esiliculosus
- Reaction: ATPASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: NUCLEOSIDE-TRIPHOSPHATASE-RXN
- Source: orthology-esiliculosus
- Reaction: RXN-12195
- Source: orthology-esiliculosus
- Reaction: RXN-12196
- Source: orthology-esiliculosus
- Reaction: RXN0-5462
- Source: orthology-esiliculosus