Difference between revisions of "ATDUDm"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16491 CPD-16491] == * smiles: ** CN([CH]=O)C1(C(O)=NC(N)=NC(N)=1) * inchi key: ** InChIKey=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DMPBQ DMPBQ] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C(C)=C(C)C(O)=1))C)C * common na...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DMPBQ DMPBQ] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C(C)=C(C)C(O)=1))C)C |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** 2,6- | + | ** 2,3-dimethyl-6-phytyl-1,4-benzoquinol |
+ | * inchi key: | ||
+ | ** InChIKey=SUFZKUBNOVDJRR-WGEODTKDSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 416.686 |
* Synonym(s): | * Synonym(s): | ||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-2542]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71768102 71768102] |
− | {{#set: smiles= | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75921 75921] |
− | {{#set: | + | * METABOLIGHTS : MTBLC75921 |
− | {{#set: molecular weight= | + | * LIGAND-CPD: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15883 C15883] | |
− | {{#set: produced by= | + | {{#set: smiles=CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C(C)=C(C)C(O)=1))C)C}} |
+ | {{#set: common name=2,3-dimethyl-6-phytyl-1,4-benzoquinol}} | ||
+ | {{#set: inchi key=InChIKey=SUFZKUBNOVDJRR-WGEODTKDSA-N}} | ||
+ | {{#set: molecular weight=416.686 }} | ||
+ | {{#set: produced by=RXN-2542}} |
Revision as of 15:57, 21 March 2018
Contents
Metabolite DMPBQ
- smiles:
- CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C(C)=C(C)C(O)=1))C)C
- common name:
- 2,3-dimethyl-6-phytyl-1,4-benzoquinol
- inchi key:
- InChIKey=SUFZKUBNOVDJRR-WGEODTKDSA-N
- molecular weight:
- 416.686
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links