Difference between revisions of "RXN-15511"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-182 RXN1G-182] == * direction: ** LEFT-TO-RIGHT * common name: ** cis,cis-delta5,23-3-oxo-C42...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10813 CPD-10813] == * smiles: ** C(C(CC1(=CC=C(C(=C1)I)OC2(=CC(=C(C(I)=C2)O)I)))[N+])([O-])...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-182 RXN1G-182] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10813 CPD-10813] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(C(CC1(=CC=C(C(=C1)I)OC2(=CC(=C(C(I)=C2)O)I)))[N+])([O-])=O
 
* common name:
 
* common name:
−
** cis,cis-delta5,23-3-oxo-C42:2-[acyl-carrier protein] reductase
+
** 3,3',5'-triiodo-L-thyronine
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.1.1.M9 EC-1.1.1.M9]
+
** InChIKey=HZCBWYNLGPIQRK-LBPRGKRZSA-N
 +
* molecular weight:
 +
** 650.978   
 
* Synonym(s):
 
* Synonym(s):
 +
** reverse triiodothyronine
 +
** rT3
 +
** triiodothyronine, reverse
 +
** 4-(4-hydroxy-3,5-diiodophenoxy)-3-iodophenylalanine
 +
** O-(4-hydroxy-3,5-diiodophenyl)-3-iodotyrosine
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-10604]]
−
** 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[cis-cis-D5-23-3-oxo-C42-2-ACPs]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[cis-cis-D5-23-3-hydroxyC42-2-ACPs]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H+[c] '''+''' 1 NADPH[c] '''+''' 1 a cis,cis-delta5,23-3-oxo-C42:2-[acp][c] '''=>''' 1 NADP+[c] '''+''' 1 a cis,cis-delta5,23-3-hydroxyC42:2-[acp][c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_13083]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
+
−
** '''86''' reactions found over '''182''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=cis,cis-delta5,23-3-oxo-C42:2-[acyl-carrier protein] reductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123465 44123465]
−
{{#set: ec number=EC-1.1.1.M9}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_13083}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57261 57261]
−
{{#set: in pathway=PWYG-321}}
+
* METABOLIGHTS : MTBLC57261
−
{{#set: reconstruction category=orthology}}
+
* LIGAND-CPD:
−
{{#set: reconstruction source=orthology-esiliculosus}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C07639 C07639]
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: smiles=C(C(CC1(=CC=C(C(=C1)I)OC2(=CC(=C(C(I)=C2)O)I)))[N+])([O-])=O}}
 +
{{#set: common name=3,3',5'-triiodo-L-thyronine}}
 +
{{#set: inchi key=InChIKey=HZCBWYNLGPIQRK-LBPRGKRZSA-N}}
 +
{{#set: molecular weight=650.978    }}
 +
{{#set: common name=reverse triiodothyronine|rT3|triiodothyronine, reverse|4-(4-hydroxy-3,5-diiodophenoxy)-3-iodophenylalanine|O-(4-hydroxy-3,5-diiodophenyl)-3-iodotyrosine}}
 +
{{#set: consumed by=RXN-10604}}

Revision as of 16:01, 21 March 2018

Metabolite CPD-10813

  • smiles:
    • C(C(CC1(=CC=C(C(=C1)I)OC2(=CC(=C(C(I)=C2)O)I)))[N+])([O-])=O
  • common name:
    • 3,3',5'-triiodo-L-thyronine
  • inchi key:
    • InChIKey=HZCBWYNLGPIQRK-LBPRGKRZSA-N
  • molecular weight:
    • 650.978
  • Synonym(s):
    • reverse triiodothyronine
    • rT3
    • triiodothyronine, reverse
    • 4-(4-hydroxy-3,5-diiodophenoxy)-3-iodophenylalanine
    • O-(4-hydroxy-3,5-diiodophenyl)-3-iodotyrosine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C(CC1(=CC=C(C(=C1)I)OC2(=CC(=C(C(I)=C2)O)I)))[N+])([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-15511&oldid=38057"