Difference between revisions of "BETAINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_5776 == * left end position: ** 200 * transcription direction: ** POSITIVE * right end position: ** 3365 * centisome position: ** 1.5466708...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14596 CPD-14596] == * smiles: ** CCC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_5776 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14596 CPD-14596] ==
−
* left end position:
+
* smiles:
−
** 200
+
** CCC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** neolinustatin
−
* right end position:
+
* inchi key:
−
** 3365
+
** InChIKey=WOSYVGNDRYBQCQ-BARGLTKPSA-N
−
* centisome position:
+
* molecular weight:
−
** 1.5466708    
+
** 423.416    
 
* Synonym(s):
 
* Synonym(s):
 +
** butanenitrile
 +
** [(2R)-2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylbutyronitrile)]
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[RXN-15556]]
+
* [[RXN-13603]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
== Pathways associated ==
+
−
* [[PWY-7511]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=200}}
+
* LIGAND-CPD:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C08336 C08336]
−
{{#set: right end position=3365}}
+
* HMDB : HMDB38482
−
{{#set: centisome position=1.5466708   }}
+
* CHEBI:
−
{{#set: reaction associated=RXN-15556|UBIQUITIN--PROTEIN-LIGASE-RXN}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=7506 7506]
−
{{#set: pathway associated=PWY-7511}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=119533 119533]
 +
{{#set: smiles=CCC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C}}
 +
{{#set: common name=neolinustatin}}
 +
{{#set: inchi key=InChIKey=WOSYVGNDRYBQCQ-BARGLTKPSA-N}}
 +
{{#set: molecular weight=423.416   }}
 +
{{#set: common name=butanenitrile|[(2R)-2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylbutyronitrile)]}}
 +
{{#set: consumed by=RXN-13603}}

Revision as of 16:06, 21 March 2018

Metabolite CPD-14596

  • smiles:
    • CCC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C
  • common name:
    • neolinustatin
  • inchi key:
    • InChIKey=WOSYVGNDRYBQCQ-BARGLTKPSA-N
  • molecular weight:
    • 423.416
  • Synonym(s):
    • butanenitrile
    • [(2R)-2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylbutyronitrile)]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=BETAINE&oldid=38814"