Difference between revisions of "Cerotoyl-ACPs"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_12113 == * Synonym(s): == Reactions associated == * GLYOXIII-RXN ** pantograph-esiliculosus == Pathways associated == == Exter...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-RIBULOSE-5-P L-RIBULOSE-5-P] == * smiles: ** C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CO * common name...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-RIBULOSE-5-P L-RIBULOSE-5-P] == |
+ | * smiles: | ||
+ | ** C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CO | ||
+ | * common name: | ||
+ | ** L-ribulose 5-phosphate | ||
+ | * inchi key: | ||
+ | ** InChIKey=FNZLKVNUWIIPSJ-CRCLSJGQSA-L | ||
+ | * molecular weight: | ||
+ | ** 228.095 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** L-ribulose-5-P | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN0-5116]] | |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 2922-69-2 |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21145006 21145006] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01101 C01101] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.20015750.html 20015750] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58226 58226] | ||
+ | * BIGG : ru5p__L | ||
+ | {{#set: smiles=C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CO}} | ||
+ | {{#set: common name=L-ribulose 5-phosphate}} | ||
+ | {{#set: inchi key=InChIKey=FNZLKVNUWIIPSJ-CRCLSJGQSA-L}} | ||
+ | {{#set: molecular weight=228.095 }} | ||
+ | {{#set: common name=L-ribulose-5-P}} | ||
+ | {{#set: produced by=RXN0-5116}} |
Revision as of 17:06, 21 March 2018
Contents
Metabolite L-RIBULOSE-5-P
- smiles:
- C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CO
- common name:
- L-ribulose 5-phosphate
- inchi key:
- InChIKey=FNZLKVNUWIIPSJ-CRCLSJGQSA-L
- molecular weight:
- 228.095
- Synonym(s):
- L-ribulose-5-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 2922-69-2
- PUBCHEM:
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : ru5p__L
"C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CO" cannot be used as a page name in this wiki.