Difference between revisions of "METHYLACETOACETYLCOATHIOL-RXN"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_15525 == * Synonym(s): == Reactions associated == * DEOXYRIBODIPYRIMIDINE-PHOTOLYASE-RXN ** pantograph-esiliculosus == Pathway...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG-PROTOPORPHYRIN MG-PROTOPORPHYRIN] == * smiles: ** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG-PROTOPORPHYRIN MG-PROTOPORPHYRIN] == |
+ | * smiles: | ||
+ | ** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)[O-])C(N56)=C7))))8)))) | ||
+ | * common name: | ||
+ | ** Mg-protoporphyrin | ||
+ | * molecular weight: | ||
+ | ** 582.94 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** Mg-protoporphyrin IX | ||
+ | ** magnesium protoporphyrin | ||
+ | ** MgP | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | * [[RXN1F-20]] |
+ | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657481 90657481] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60492 60492] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C03516 C03516] | ||
+ | {{#set: smiles=C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)[O-])C(N56)=C7))))8))))}} | ||
+ | {{#set: common name=Mg-protoporphyrin}} | ||
+ | {{#set: molecular weight=582.94 }} | ||
+ | {{#set: common name=Mg-protoporphyrin IX|magnesium protoporphyrin|MgP}} | ||
+ | {{#set: consumed by=RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN}} | ||
+ | {{#set: produced by=RXN1F-20}} |
Revision as of 16:08, 21 March 2018
Contents
Metabolite MG-PROTOPORPHYRIN
- smiles:
- C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)[O-])C(N56)=C7))))8))))
- common name:
- Mg-protoporphyrin
- molecular weight:
- 582.94
- Synonym(s):
- Mg-protoporphyrin IX
- magnesium protoporphyrin
- MgP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)[O-])C(N56)=C7))))8))))" cannot be used as a page name in this wiki.