Difference between revisions of "CPD-700"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7720 PWY-7720] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-700 CPD-700] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-700 CPD-700] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34)))) |
* common name: | * common name: | ||
| − | ** | + | ** ergosta-5,7,24(28)-trien-3β-ol |
| + | * inchi key: | ||
| + | ** InChIKey=ZEPNVCGPJXYABB-LOIOQLKMSA-N | ||
| + | * molecular weight: | ||
| + | ** 396.655 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 5,7,24(28)-ergostatrienol | ||
| + | ** 5-dehydro episterol | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-707]] | |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN3O-218]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15780 C15780] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=52972 52972] |
| − | {{#set: | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10894570 10894570] | ||
| + | * HMDB : HMDB06848 | ||
| + | {{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} | ||
| + | {{#set: common name=ergosta-5,7,24(28)-trien-3β-ol}} | ||
| + | {{#set: inchi key=InChIKey=ZEPNVCGPJXYABB-LOIOQLKMSA-N}} | ||
| + | {{#set: molecular weight=396.655 }} | ||
| + | {{#set: common name=5,7,24(28)-ergostatrienol|5-dehydro episterol}} | ||
| + | {{#set: consumed by=RXN-707}} | ||
| + | {{#set: produced by=RXN3O-218}} | ||
Latest revision as of 19:09, 21 March 2018
Contents
Metabolite CPD-700
- smiles:
- CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- common name:
- ergosta-5,7,24(28)-trien-3β-ol
- inchi key:
- InChIKey=ZEPNVCGPJXYABB-LOIOQLKMSA-N
- molecular weight:
- 396.655
- Synonym(s):
- 5,7,24(28)-ergostatrienol
- 5-dehydro episterol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
