Difference between revisions of "ILEUSYN-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAQUINONE DOPAQUINONE] == * smiles: ** C([O-])(=O)C([N+])CC1(=CC(=O)C(=O)C=C1) * common name:...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ILEUSYN-PWY ILEUSYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ILEUSYN-PWY ILEUSYN-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | ||
* common name: | * common name: | ||
− | ** | + | ** L-isoleucine biosynthesis I (from threonine) |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''7''' reactions found over '''7''' reactions in the full pathway |
− | * [[RXN- | + | * [[ACETOOHBUTREDUCTOISOM-RXN]] |
− | + | ** 1 associated gene(s): | |
− | * [[RXN- | + | *** [[Tiso_gene_10173]] |
− | * [[ | + | ** 3 reconstruction source(s) associated: |
− | == Reaction(s) | + | *** [[manual-primary_network]] |
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[ACETOOHBUTSYN-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_11362]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | * [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Tiso_gene_14984]] | ||
+ | *** [[Tiso_gene_18403]] | ||
+ | *** [[Tiso_gene_17748]] | ||
+ | ** 7 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | * [[DIHYDROXYMETVALDEHYDRAT-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_1563]] | ||
+ | ** 6 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | * [[RXN-15121]] | ||
+ | ** 0 associated gene: | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | * [[RXN-15122]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Tiso_gene_8525]] | ||
+ | *** [[Tiso_gene_17207]] | ||
+ | *** [[Tiso_gene_12535]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-15123]] | ||
+ | ** 0 associated gene: | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=ILEUSYN-PWY ILEUSYN-PWY] |
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=L-isoleucine biosynthesis I (from threonine)}} | |
− | + | {{#set: reaction found=7}} | |
− | + | {{#set: total reaction=7}} | |
− | + | {{#set: completion rate=100.0}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:29, 21 March 2018
Pathway ILEUSYN-PWY
- taxonomic range:
- common name:
- L-isoleucine biosynthesis I (from threonine)
- Synonym(s):
Reaction(s) found
7 reactions found over 7 reactions in the full pathway
- ACETOOHBUTREDUCTOISOM-RXN
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
- ACETOOHBUTSYN-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- BRANCHED-CHAINAMINOTRANSFERILEU-RXN
- 3 associated gene(s):
- 7 reconstruction source(s) associated:
- DIHYDROXYMETVALDEHYDRAT-RXN
- 1 associated gene(s):
- 6 reconstruction source(s) associated:
- RXN-15121
- 0 associated gene:
- 2 reconstruction source(s) associated:
- RXN-15122
- 3 associated gene(s):
- 3 reconstruction source(s) associated:
- RXN-15123
- 0 associated gene:
- 2 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: